About (1R,2R)-2-(methoxymethyl)-1-phenyl-1-sulfanylidene-1λ5-phospholane
(1R,2R)-2-(methoxymethyl)-1-phenyl-1-sulfanylidene-1λ5-phospholane (PubChem CID 69259732) has the molecular formula C12H17OPS
and a molecular weight of 240.31 g/mol. Its IUPAC name is (1R,2R)-2-(methoxymethyl)-1-phenyl-1-sulfanylidene-1λ5-phospholane.
Molecular Properties
| Compound Name | (1R,2R)-2-(methoxymethyl)-1-phenyl-1-sulfanylidene-1λ5-phospholane |
| PubChem CID | 69259732 |
| Molecular Formula | C12H17OPS |
| Molecular Weight | 240.31 g/mol |
| Exact Mass | 240.07 |
| IUPAC Name | (1R,2R)-2-(methoxymethyl)-1-phenyl-1-sulfanylidene-1λ5-phospholane |
| SMILES | COC[C@H]1CCC[P@]1(=S)c1ccccc1 |
| InChI | InChI=1S/C12H17OPS/c1-13-10-12-8-5-9-14(12,15)11-6-3-2-4-7-11/h2-4,6-7,12H,5,8-10H2,1H3/t12-,14+/m1/s1 |
| InChIKey | RVJFURYVFLYYIW-OCCSQVGLSA-N |
| XLogP | 2.60 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.31 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (1R,2R)-2-(methoxymethyl)-1-phenyl-1-sulfanylidene-1λ5-phospholane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R,2R)-2-(methoxymethyl)-1-phenyl-1-sulfanylidene-1λ5-phospholane?
The IUPAC name of (1R,2R)-2-(methoxymethyl)-1-phenyl-1-sulfanylidene-1λ5-phospholane (CID 69259732) is (1R,2R)-2-(methoxymethyl)-1-phenyl-1-sulfanylidene-1λ5-phospholane.
What is the SMILES notation for (1R,2R)-2-(methoxymethyl)-1-phenyl-1-sulfanylidene-1λ5-phospholane?
The canonical SMILES for (1R,2R)-2-(methoxymethyl)-1-phenyl-1-sulfanylidene-1λ5-phospholane is COC[C@H]1CCC[P@]1(=S)c1ccccc1.
What is the InChIKey of (1R,2R)-2-(methoxymethyl)-1-phenyl-1-sulfanylidene-1λ5-phospholane?
The InChIKey is RVJFURYVFLYYIW-OCCSQVGLSA-N. The full InChI is InChI=1S/C12H17OPS/c1-13-10-12-8-5-9-14(12,15)11-6-3-2-4-7-11/h2-4,6-7,12H,5,8-10H2,1H3/t12-,14+/m1/s1.
What are the key properties of (1R,2R)-2-(methoxymethyl)-1-phenyl-1-sulfanylidene-1λ5-phospholane?
(1R,2R)-2-(methoxymethyl)-1-phenyl-1-sulfanylidene-1λ5-phospholane has a molecular weight of 240.31 g/mol, XLogP of 2.60, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1R,2R)-2-(methoxymethyl)-1-phenyl-1-sulfanylidene-1λ5-phospholane is sourced from PubChem (CID 69259732), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).