C27H34N4O3 — CID 69259860
N-(3-aminopropyl)-N-[1-(4-benzyl-6-ethylidene-5-oxo-1,2,4-oxadiazin-3-yl)-2-methylpropyl]-4-methylbenzamide (PubChem CID 69259860) has the molecular formula C27H34N4O3 and a molecular weight of 462.59 g/mol. Its IUPAC name is N-(3-aminopropyl)-N-[1-(4-benzyl-6-ethylidene-5-oxo-1,2,4-oxadiazin-3-yl)-2-methylpropyl]-4-methylbenzamide.
| Compound Name | N-(3-aminopropyl)-N-[1-(4-benzyl-6-ethylidene-5-oxo-1,2,4-oxadiazin-3-yl)-2-methylpropyl]-4-methylbenzamide |
|---|---|
| PubChem CID | 69259860 |
| Molecular Formula | C27H34N4O3 |
| Molecular Weight | 462.59 g/mol |
| Exact Mass | 462.26 |
| IUPAC Name | N-(3-aminopropyl)-N-[1-(4-benzyl-6-ethylidene-5-oxo-1,2,4-oxadiazin-3-yl)-2-methylpropyl]-4-methylbenzamide |
| SMILES | CC=C1ON=C(C(C(C)C)N(CCCN)C(=O)c2ccc(C)cc2)N(Cc2ccccc2)C1=O |
| InChI | InChI=1S/C27H34N4O3/c1-5-23-27(33)31(18-21-10-7-6-8-11-21)25(29-34-23)24(19(2)3)30(17-9-16-28)26(32)22-14-12-20(4)13-15-22/h5-8,10-15,19,24H,9,16-18,28H2,1-4H3 |
| InChIKey | HMQPLFOUSZMUJS-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 88.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.59 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|