About 2-[2-chloro-4-(2,3-dimethoxyphenyl)phenyl]-N-methyl-1,3-dioxol-2-amine
2-[2-chloro-4-(2,3-dimethoxyphenyl)phenyl]-N-methyl-1,3-dioxol-2-amine (PubChem CID 69259909) has the molecular formula C18H18ClNO4
and a molecular weight of 347.80 g/mol. Its IUPAC name is 2-[2-chloro-4-(2,3-dimethoxyphenyl)phenyl]-N-methyl-1,3-dioxol-2-amine.
Molecular Properties
| Compound Name | 2-[2-chloro-4-(2,3-dimethoxyphenyl)phenyl]-N-methyl-1,3-dioxol-2-amine |
| PubChem CID | 69259909 |
| Molecular Formula | C18H18ClNO4 |
| Molecular Weight | 347.80 g/mol |
| Exact Mass | 347.09 |
| IUPAC Name | 2-[2-chloro-4-(2,3-dimethoxyphenyl)phenyl]-N-methyl-1,3-dioxol-2-amine |
| SMILES | CNC1(c2ccc(-c3cccc(OC)c3OC)cc2Cl)OC=CO1 |
| InChI | InChI=1S/C18H18ClNO4/c1-20-18(23-9-10-24-18)14-8-7-12(11-15(14)19)13-5-4-6-16(21-2)17(13)22-3/h4-11,20H,1-3H3 |
| InChIKey | SIXSFZOBTQTQJK-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 48.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.80 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[2-chloro-4-(2,3-dimethoxyphenyl)phenyl]-N-methyl-1,3-dioxol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-chloro-4-(2,3-dimethoxyphenyl)phenyl]-N-methyl-1,3-dioxol-2-amine?
The IUPAC name of 2-[2-chloro-4-(2,3-dimethoxyphenyl)phenyl]-N-methyl-1,3-dioxol-2-amine (CID 69259909) is 2-[2-chloro-4-(2,3-dimethoxyphenyl)phenyl]-N-methyl-1,3-dioxol-2-amine.
What is the SMILES notation for 2-[2-chloro-4-(2,3-dimethoxyphenyl)phenyl]-N-methyl-1,3-dioxol-2-amine?
The canonical SMILES for 2-[2-chloro-4-(2,3-dimethoxyphenyl)phenyl]-N-methyl-1,3-dioxol-2-amine is CNC1(c2ccc(-c3cccc(OC)c3OC)cc2Cl)OC=CO1.
What is the InChIKey of 2-[2-chloro-4-(2,3-dimethoxyphenyl)phenyl]-N-methyl-1,3-dioxol-2-amine?
The InChIKey is SIXSFZOBTQTQJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18ClNO4/c1-20-18(23-9-10-24-18)14-8-7-12(11-15(14)19)13-5-4-6-16(21-2)17(13)22-3/h4-11,20H,1-3H3.
What are the key properties of 2-[2-chloro-4-(2,3-dimethoxyphenyl)phenyl]-N-methyl-1,3-dioxol-2-amine?
2-[2-chloro-4-(2,3-dimethoxyphenyl)phenyl]-N-methyl-1,3-dioxol-2-amine has a molecular weight of 347.80 g/mol, XLogP of 3.87, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-chloro-4-(2,3-dimethoxyphenyl)phenyl]-N-methyl-1,3-dioxol-2-amine is sourced from PubChem (CID 69259909), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).