About N-(3-chloro-1-pyridin-3-ylpyrazol-4-yl)-5,5,5-trifluoropentanamide
N-(3-chloro-1-pyridin-3-ylpyrazol-4-yl)-5,5,5-trifluoropentanamide (PubChem CID 69259975) has the molecular formula C13H12ClF3N4O
and a molecular weight of 332.71 g/mol. Its IUPAC name is N-(3-chloro-1-pyridin-3-ylpyrazol-4-yl)-5,5,5-trifluoropentanamide.
Molecular Properties
| Compound Name | N-(3-chloro-1-pyridin-3-ylpyrazol-4-yl)-5,5,5-trifluoropentanamide |
| PubChem CID | 69259975 |
| Molecular Formula | C13H12ClF3N4O |
| Molecular Weight | 332.71 g/mol |
| Exact Mass | 332.07 |
| IUPAC Name | N-(3-chloro-1-pyridin-3-ylpyrazol-4-yl)-5,5,5-trifluoropentanamide |
| SMILES | O=C(CCCC(F)(F)F)Nc1cn(-c2cccnc2)nc1Cl |
| InChI | InChI=1S/C13H12ClF3N4O/c14-12-10(19-11(22)4-1-5-13(15,16)17)8-21(20-12)9-3-2-6-18-7-9/h2-3,6-8H,1,4-5H2,(H,19,22) |
| InChIKey | DOLARJISUWILHT-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.71 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(3-chloro-1-pyridin-3-ylpyrazol-4-yl)-5,5,5-trifluoropentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-chloro-1-pyridin-3-ylpyrazol-4-yl)-5,5,5-trifluoropentanamide?
The IUPAC name of N-(3-chloro-1-pyridin-3-ylpyrazol-4-yl)-5,5,5-trifluoropentanamide (CID 69259975) is N-(3-chloro-1-pyridin-3-ylpyrazol-4-yl)-5,5,5-trifluoropentanamide.
What is the SMILES notation for N-(3-chloro-1-pyridin-3-ylpyrazol-4-yl)-5,5,5-trifluoropentanamide?
The canonical SMILES for N-(3-chloro-1-pyridin-3-ylpyrazol-4-yl)-5,5,5-trifluoropentanamide is O=C(CCCC(F)(F)F)Nc1cn(-c2cccnc2)nc1Cl.
What is the InChIKey of N-(3-chloro-1-pyridin-3-ylpyrazol-4-yl)-5,5,5-trifluoropentanamide?
The InChIKey is DOLARJISUWILHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12ClF3N4O/c14-12-10(19-11(22)4-1-5-13(15,16)17)8-21(20-12)9-3-2-6-18-7-9/h2-3,6-8H,1,4-5H2,(H,19,22).
What are the key properties of N-(3-chloro-1-pyridin-3-ylpyrazol-4-yl)-5,5,5-trifluoropentanamide?
N-(3-chloro-1-pyridin-3-ylpyrazol-4-yl)-5,5,5-trifluoropentanamide has a molecular weight of 332.71 g/mol, XLogP of 3.59, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-chloro-1-pyridin-3-ylpyrazol-4-yl)-5,5,5-trifluoropentanamide is sourced from PubChem (CID 69259975), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).