C26H33NO7 — CID 69260202
2-[(4-ethylphenyl)methyl]-5-propan-2-yloxy-4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)-2-methoxyoxan-2-yl]benzonitrile (PubChem CID 69260202) has the molecular formula C26H33NO7 and a molecular weight of 471.55 g/mol. Its IUPAC name is 2-[(4-ethylphenyl)methyl]-5-propan-2-yloxy-4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)-2-methoxyoxan-2-yl]benzonitrile.
| Compound Name | 2-[(4-ethylphenyl)methyl]-5-propan-2-yloxy-4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)-2-methoxyoxan-2-yl]benzonitrile |
|---|---|
| PubChem CID | 69260202 |
| Molecular Formula | C26H33NO7 |
| Molecular Weight | 471.55 g/mol |
| Exact Mass | 471.23 |
| IUPAC Name | 2-[(4-ethylphenyl)methyl]-5-propan-2-yloxy-4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)-2-methoxyoxan-2-yl]benzonitrile |
| SMILES | CCc1ccc(Cc2cc([C@]3(OC)O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)c(OC(C)C)cc2C#N)cc1 |
| InChI | InChI=1S/C26H33NO7/c1-5-16-6-8-17(9-7-16)10-18-11-20(21(33-15(2)3)12-19(18)13-27)26(32-4)25(31)24(30)23(29)22(14-28)34-26/h6-9,11-12,15,22-25,28-31H,5,10,14H2,1-4H3/t22-,23-,24+,25-,26+/m1/s1 |
| InChIKey | ZYRIYYASFJKHLA-RTJMFUJLSA-N |
| XLogP | 1.77 |
| TPSA | 132.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.55 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |