About 1-[3,3-dimethylbutanoyl-(2-phenylphenyl)phosphanyl]-3,3-dimethylbutan-1-one
1-[3,3-dimethylbutanoyl-(2-phenylphenyl)phosphanyl]-3,3-dimethylbutan-1-one (PubChem CID 69260618) has the molecular formula C24H31O2P
and a molecular weight of 382.48 g/mol. Its IUPAC name is 1-[3,3-dimethylbutanoyl-(2-phenylphenyl)phosphanyl]-3,3-dimethylbutan-1-one.
Molecular Properties
| Compound Name | 1-[3,3-dimethylbutanoyl-(2-phenylphenyl)phosphanyl]-3,3-dimethylbutan-1-one |
| PubChem CID | 69260618 |
| Molecular Formula | C24H31O2P |
| Molecular Weight | 382.48 g/mol |
| Exact Mass | 382.21 |
| IUPAC Name | 1-[3,3-dimethylbutanoyl-(2-phenylphenyl)phosphanyl]-3,3-dimethylbutan-1-one |
| SMILES | CC(C)(C)CC(=O)P(C(=O)CC(C)(C)C)c1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C24H31O2P/c1-23(2,3)16-21(25)27(22(26)17-24(4,5)6)20-15-11-10-14-19(20)18-12-8-7-9-13-18/h7-15H,16-17H2,1-6H3 |
| InChIKey | ONHFRKQMFVKHJR-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 382.48 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 1-[3,3-dimethylbutanoyl-(2-phenylphenyl)phosphanyl]-3,3-dimethylbutan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3,3-dimethylbutanoyl-(2-phenylphenyl)phosphanyl]-3,3-dimethylbutan-1-one?
The IUPAC name of 1-[3,3-dimethylbutanoyl-(2-phenylphenyl)phosphanyl]-3,3-dimethylbutan-1-one (CID 69260618) is 1-[3,3-dimethylbutanoyl-(2-phenylphenyl)phosphanyl]-3,3-dimethylbutan-1-one.
What is the SMILES notation for 1-[3,3-dimethylbutanoyl-(2-phenylphenyl)phosphanyl]-3,3-dimethylbutan-1-one?
The canonical SMILES for 1-[3,3-dimethylbutanoyl-(2-phenylphenyl)phosphanyl]-3,3-dimethylbutan-1-one is CC(C)(C)CC(=O)P(C(=O)CC(C)(C)C)c1ccccc1-c1ccccc1.
What is the InChIKey of 1-[3,3-dimethylbutanoyl-(2-phenylphenyl)phosphanyl]-3,3-dimethylbutan-1-one?
The InChIKey is ONHFRKQMFVKHJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H31O2P/c1-23(2,3)16-21(25)27(22(26)17-24(4,5)6)20-15-11-10-14-19(20)18-12-8-7-9-13-18/h7-15H,16-17H2,1-6H3.
What are the key properties of 1-[3,3-dimethylbutanoyl-(2-phenylphenyl)phosphanyl]-3,3-dimethylbutan-1-one?
1-[3,3-dimethylbutanoyl-(2-phenylphenyl)phosphanyl]-3,3-dimethylbutan-1-one has a molecular weight of 382.48 g/mol, XLogP of 6.39, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3,3-dimethylbutanoyl-(2-phenylphenyl)phosphanyl]-3,3-dimethylbutan-1-one is sourced from PubChem (CID 69260618), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).