C11H16N2O — CID 69260841
2,2-dimethyl-3,4-dihydrochromene-3,8-diamine (PubChem CID 69260841) has the molecular formula C11H16N2O and a molecular weight of 192.26 g/mol. Its IUPAC name is 2,2-dimethyl-3,4-dihydrochromene-3,8-diamine.
| Compound Name | 2,2-dimethyl-3,4-dihydrochromene-3,8-diamine |
|---|---|
| PubChem CID | 69260841 |
| Molecular Formula | C11H16N2O |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.13 |
| IUPAC Name | 2,2-dimethyl-3,4-dihydrochromene-3,8-diamine |
| SMILES | CC1(C)Oc2c(N)cccc2CC1N |
| InChI | InChI=1S/C11H16N2O/c1-11(2)9(13)6-7-4-3-5-8(12)10(7)14-11/h3-5,9H,6,12-13H2,1-2H3 |
| InChIKey | MTMZPASKGSKXEI-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|