C16H25F3N2O7 — CID 69260974
1-[3-[2-[2-(3-aminopropoxy)ethoxy]ethoxy]propyl]pyrrole-2,5-dione;2,2,2-trifluoroacetic acid (PubChem CID 69260974) has the molecular formula C16H25F3N2O7 and a molecular weight of 414.38 g/mol. Its IUPAC name is 1-[3-[2-[2-(3-aminopropoxy)ethoxy]ethoxy]propyl]pyrrole-2,5-dione;2,2,2-trifluoroacetic acid.
| Compound Name | 1-[3-[2-[2-(3-aminopropoxy)ethoxy]ethoxy]propyl]pyrrole-2,5-dione;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 69260974 |
| Molecular Formula | C16H25F3N2O7 |
| Molecular Weight | 414.38 g/mol |
| Exact Mass | 414.16 |
| IUPAC Name | 1-[3-[2-[2-(3-aminopropoxy)ethoxy]ethoxy]propyl]pyrrole-2,5-dione;2,2,2-trifluoroacetic acid |
| SMILES | NCCCOCCOCCOCCCN1C(=O)C=CC1=O.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C14H24N2O5.C2HF3O2/c15-5-1-7-19-9-11-21-12-10-20-8-2-6-16-13(17)3-4-14(16)18;3-2(4,5)1(6)7/h3-4H,1-2,5-12,15H2;(H,6,7) |
| InChIKey | PXJVYPQAXNNFIT-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 128.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.38 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|