C8H13N3S — CID 6926103
1-amino-3-[(1S,2S,4R)-2-bicyclo[2.2.1]hept-5-enyl]thiourea (PubChem CID 6926103) has the molecular formula C8H13N3S and a molecular weight of 183.28 g/mol. Its IUPAC name is 1-amino-3-[(1S,2S,4R)-2-bicyclo[2.2.1]hept-5-enyl]thiourea.
| Compound Name | 1-amino-3-[(1S,2S,4R)-2-bicyclo[2.2.1]hept-5-enyl]thiourea |
|---|---|
| PubChem CID | 6926103 |
| Molecular Formula | C8H13N3S |
| Molecular Weight | 183.28 g/mol |
| Exact Mass | 183.08 |
| IUPAC Name | 1-amino-3-[(1S,2S,4R)-2-bicyclo[2.2.1]hept-5-enyl]thiourea |
| SMILES | NNC(=S)N[C@H]1C[C@@H]2C=C[C@@H]1C2 |
| InChI | InChI=1S/C8H13N3S/c9-11-8(12)10-7-4-5-1-2-6(7)3-5/h1-2,5-7H,3-4,9H2,(H2,10,11,12)/t5-,6-,7+/m1/s1 |
| InChIKey | RSNPMWAHSFCPGD-QYNIQEEDSA-N |
| XLogP | 0.29 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.28 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|