C48H66O9 — CID 69261130
tris[4-oxo-4-(2,6,6-trimethylcyclohex-3-en-1-yl)butan-2-yl] benzene-1,3,5-tricarboxylate (PubChem CID 69261130) has the molecular formula C48H66O9 and a molecular weight of 787.05 g/mol. Its IUPAC name is tris[4-oxo-4-(2,6,6-trimethylcyclohex-3-en-1-yl)butan-2-yl] benzene-1,3,5-tricarboxylate.
| Compound Name | tris[4-oxo-4-(2,6,6-trimethylcyclohex-3-en-1-yl)butan-2-yl] benzene-1,3,5-tricarboxylate |
|---|---|
| PubChem CID | 69261130 |
| Molecular Formula | C48H66O9 |
| Molecular Weight | 787.05 g/mol |
| Exact Mass | 786.47 |
| IUPAC Name | tris[4-oxo-4-(2,6,6-trimethylcyclohex-3-en-1-yl)butan-2-yl] benzene-1,3,5-tricarboxylate |
| SMILES | CC(CC(=O)C1C(C)C=CCC1(C)C)OC(=O)c1cc(C(=O)OC(C)CC(=O)C2C(C)C=CCC2(C)C)cc(C(=O)OC(C)CC(=O)C2C(C)C=CCC2(C)C)c1 |
| InChI | InChI=1S/C48H66O9/c1-28-16-13-19-46(7,8)40(28)37(49)22-31(4)55-43(52)34-25-35(44(53)56-32(5)23-38(50)41-29(2)17-14-20-47(41,9)10)27-36(26-34)45(54)57-33(6)24-39(51)42-30(3)18-15-21-48(42,11)12/h13-18,25-33,40-42H,19-24H2,1-12H3 |
| InChIKey | UPATWGCKQJILNW-UHFFFAOYSA-N |
| XLogP | 9.92 |
| TPSA | 130.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 787.05 |
| LogP ≤ 5 | 9.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|