C34H45N3O4 — CID 69261329
methyl 2-cyclohexyl-3-[3-[3-[5-(2,6-dimethylbenzoyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]phenyl]propylamino]-3-oxopropanoate (PubChem CID 69261329) has the molecular formula C34H45N3O4 and a molecular weight of 559.75 g/mol. Its IUPAC name is methyl 2-cyclohexyl-3-[3-[3-[5-(2,6-dimethylbenzoyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]phenyl]propylamino]-3-oxopropanoate.
| Compound Name | methyl 2-cyclohexyl-3-[3-[3-[5-(2,6-dimethylbenzoyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]phenyl]propylamino]-3-oxopropanoate |
|---|---|
| PubChem CID | 69261329 |
| Molecular Formula | C34H45N3O4 |
| Molecular Weight | 559.75 g/mol |
| Exact Mass | 559.34 |
| IUPAC Name | methyl 2-cyclohexyl-3-[3-[3-[5-(2,6-dimethylbenzoyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]phenyl]propylamino]-3-oxopropanoate |
| SMILES | COC(=O)C(C(=O)NCCCc1cccc(N2CC3CN(C(=O)c4c(C)cccc4C)CC3C2)c1)C1CCCCC1 |
| InChI | InChI=1S/C34H45N3O4/c1-23-10-7-11-24(2)30(23)33(39)37-21-27-19-36(20-28(27)22-37)29-16-8-12-25(18-29)13-9-17-35-32(38)31(34(40)41-3)26-14-5-4-6-15-26/h7-8,10-12,16,18,26-28,31H,4-6,9,13-15,17,19-22H2,1-3H3,(H,35,38) |
| InChIKey | ZCMOYTBBEJCGQW-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.75 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|