(5-methylpyrazolo[1,5-a]pyridin-2-yl) hydrogen carbonate

C9H8N2O3 — CID 69261451

IUPAC(5-methylpyrazolo[1,5-a]pyridin-2-yl) hydrogen carbonate
SMILESCc1ccn2nc(OC(=O)O)cc2c1
InChIInChI=1S/C9H8N2O3/c1-6-2-3-11-7(4-6)5-8(10-11)14-9(12)13/h2-5H,1H3,(H,12,13)
InChIKeyQYVSMRCLZARBAP-UHFFFAOYSA-N
MW192.17 g/mol
LogP1.70
Rot. Bonds1

About (5-methylpyrazolo[1,5-a]pyridin-2-yl) hydrogen carbonate

(5-methylpyrazolo[1,5-a]pyridin-2-yl) hydrogen carbonate (PubChem CID 69261451) has the molecular formula C9H8N2O3 and a molecular weight of 192.17 g/mol. Its IUPAC name is (5-methylpyrazolo[1,5-a]pyridin-2-yl) hydrogen carbonate.

Molecular Properties

Compound Name(5-methylpyrazolo[1,5-a]pyridin-2-yl) hydrogen carbonate
PubChem CID69261451
Molecular FormulaC9H8N2O3
Molecular Weight192.17 g/mol
Exact Mass192.05
IUPAC Name(5-methylpyrazolo[1,5-a]pyridin-2-yl) hydrogen carbonate
SMILESCc1ccn2nc(OC(=O)O)cc2c1
InChIInChI=1S/C9H8N2O3/c1-6-2-3-11-7(4-6)5-8(10-11)14-9(12)13/h2-5H,1H3,(H,12,13)
InChIKeyQYVSMRCLZARBAP-UHFFFAOYSA-N
XLogP1.70
TPSA63.83 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500192.17
LogP ≤ 51.70
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze (5-methylpyrazolo[1,5-a]pyridin-2-yl) hydrogen carbonate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (5-methylpyrazolo[1,5-a]pyridin-2-yl) hydrogen carbonate?
The IUPAC name of (5-methylpyrazolo[1,5-a]pyridin-2-yl) hydrogen carbonate (CID 69261451) is (5-methylpyrazolo[1,5-a]pyridin-2-yl) hydrogen carbonate.
What is the SMILES notation for (5-methylpyrazolo[1,5-a]pyridin-2-yl) hydrogen carbonate?
The canonical SMILES for (5-methylpyrazolo[1,5-a]pyridin-2-yl) hydrogen carbonate is Cc1ccn2nc(OC(=O)O)cc2c1.
What is the InChIKey of (5-methylpyrazolo[1,5-a]pyridin-2-yl) hydrogen carbonate?
The InChIKey is QYVSMRCLZARBAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N2O3/c1-6-2-3-11-7(4-6)5-8(10-11)14-9(12)13/h2-5H,1H3,(H,12,13).
What are the key properties of (5-methylpyrazolo[1,5-a]pyridin-2-yl) hydrogen carbonate?
(5-methylpyrazolo[1,5-a]pyridin-2-yl) hydrogen carbonate has a molecular weight of 192.17 g/mol, XLogP of 1.70, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (5-methylpyrazolo[1,5-a]pyridin-2-yl) hydrogen carbonate is sourced from PubChem (CID 69261451), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).