About 8-ethyl-2-phenyl-4H-1,4-benzoxazin-3-one
8-ethyl-2-phenyl-4H-1,4-benzoxazin-3-one (PubChem CID 69261563) has the molecular formula C16H15NO2
and a molecular weight of 253.30 g/mol. Its IUPAC name is 8-ethyl-2-phenyl-4H-1,4-benzoxazin-3-one.
Molecular Properties
| Compound Name | 8-ethyl-2-phenyl-4H-1,4-benzoxazin-3-one |
| PubChem CID | 69261563 |
| Molecular Formula | C16H15NO2 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | 8-ethyl-2-phenyl-4H-1,4-benzoxazin-3-one |
| SMILES | CCc1cccc2c1OC(c1ccccc1)C(=O)N2 |
| InChI | InChI=1S/C16H15NO2/c1-2-11-9-6-10-13-14(11)19-15(16(18)17-13)12-7-4-3-5-8-12/h3-10,15H,2H2,1H3,(H,17,18) |
| InChIKey | MYZVROKSRGMGIC-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 8-ethyl-2-phenyl-4H-1,4-benzoxazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-ethyl-2-phenyl-4H-1,4-benzoxazin-3-one?
The IUPAC name of 8-ethyl-2-phenyl-4H-1,4-benzoxazin-3-one (CID 69261563) is 8-ethyl-2-phenyl-4H-1,4-benzoxazin-3-one.
What is the SMILES notation for 8-ethyl-2-phenyl-4H-1,4-benzoxazin-3-one?
The canonical SMILES for 8-ethyl-2-phenyl-4H-1,4-benzoxazin-3-one is CCc1cccc2c1OC(c1ccccc1)C(=O)N2.
What is the InChIKey of 8-ethyl-2-phenyl-4H-1,4-benzoxazin-3-one?
The InChIKey is MYZVROKSRGMGIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15NO2/c1-2-11-9-6-10-13-14(11)19-15(16(18)17-13)12-7-4-3-5-8-12/h3-10,15H,2H2,1H3,(H,17,18).
What are the key properties of 8-ethyl-2-phenyl-4H-1,4-benzoxazin-3-one?
8-ethyl-2-phenyl-4H-1,4-benzoxazin-3-one has a molecular weight of 253.30 g/mol, XLogP of 3.32, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-ethyl-2-phenyl-4H-1,4-benzoxazin-3-one is sourced from PubChem (CID 69261563), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).