About ethyl 4-(8-tert-butyl-2-propan-2-yl-2,3-dihydro-1,4-benzoxazin-4-yl)-4-oxobut-2-enoate
ethyl 4-(8-tert-butyl-2-propan-2-yl-2,3-dihydro-1,4-benzoxazin-4-yl)-4-oxobut-2-enoate (PubChem CID 69262147) has the molecular formula C21H29NO4
and a molecular weight of 359.47 g/mol. Its IUPAC name is ethyl 4-(8-tert-butyl-2-propan-2-yl-2,3-dihydro-1,4-benzoxazin-4-yl)-4-oxobut-2-enoate.
Molecular Properties
| Compound Name | ethyl 4-(8-tert-butyl-2-propan-2-yl-2,3-dihydro-1,4-benzoxazin-4-yl)-4-oxobut-2-enoate |
| PubChem CID | 69262147 |
| Molecular Formula | C21H29NO4 |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.21 |
| IUPAC Name | ethyl 4-(8-tert-butyl-2-propan-2-yl-2,3-dihydro-1,4-benzoxazin-4-yl)-4-oxobut-2-enoate |
| SMILES | CCOC(=O)C=CC(=O)N1CC(C(C)C)Oc2c1cccc2C(C)(C)C |
| InChI | InChI=1S/C21H29NO4/c1-7-25-19(24)12-11-18(23)22-13-17(14(2)3)26-20-15(21(4,5)6)9-8-10-16(20)22/h8-12,14,17H,7,13H2,1-6H3 |
| InChIKey | SPKOOSGBCCRAEX-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl 4-(8-tert-butyl-2-propan-2-yl-2,3-dihydro-1,4-benzoxazin-4-yl)-4-oxobut-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-(8-tert-butyl-2-propan-2-yl-2,3-dihydro-1,4-benzoxazin-4-yl)-4-oxobut-2-enoate?
The IUPAC name of ethyl 4-(8-tert-butyl-2-propan-2-yl-2,3-dihydro-1,4-benzoxazin-4-yl)-4-oxobut-2-enoate (CID 69262147) is ethyl 4-(8-tert-butyl-2-propan-2-yl-2,3-dihydro-1,4-benzoxazin-4-yl)-4-oxobut-2-enoate.
What is the SMILES notation for ethyl 4-(8-tert-butyl-2-propan-2-yl-2,3-dihydro-1,4-benzoxazin-4-yl)-4-oxobut-2-enoate?
The canonical SMILES for ethyl 4-(8-tert-butyl-2-propan-2-yl-2,3-dihydro-1,4-benzoxazin-4-yl)-4-oxobut-2-enoate is CCOC(=O)C=CC(=O)N1CC(C(C)C)Oc2c1cccc2C(C)(C)C.
What is the InChIKey of ethyl 4-(8-tert-butyl-2-propan-2-yl-2,3-dihydro-1,4-benzoxazin-4-yl)-4-oxobut-2-enoate?
The InChIKey is SPKOOSGBCCRAEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H29NO4/c1-7-25-19(24)12-11-18(23)22-13-17(14(2)3)26-20-15(21(4,5)6)9-8-10-16(20)22/h8-12,14,17H,7,13H2,1-6H3.
What are the key properties of ethyl 4-(8-tert-butyl-2-propan-2-yl-2,3-dihydro-1,4-benzoxazin-4-yl)-4-oxobut-2-enoate?
ethyl 4-(8-tert-butyl-2-propan-2-yl-2,3-dihydro-1,4-benzoxazin-4-yl)-4-oxobut-2-enoate has a molecular weight of 359.47 g/mol, XLogP of 3.85, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-(8-tert-butyl-2-propan-2-yl-2,3-dihydro-1,4-benzoxazin-4-yl)-4-oxobut-2-enoate is sourced from PubChem (CID 69262147), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).