About N-ethyl-4,4,4-trifluoro-3-methylsulfanyl-N-(1-pyridin-3-ylpyrazol-4-yl)butanamide
N-ethyl-4,4,4-trifluoro-3-methylsulfanyl-N-(1-pyridin-3-ylpyrazol-4-yl)butanamide (PubChem CID 69262153) has the molecular formula C15H17F3N4OS
and a molecular weight of 358.39 g/mol. Its IUPAC name is N-ethyl-4,4,4-trifluoro-3-methylsulfanyl-N-(1-pyridin-3-ylpyrazol-4-yl)butanamide.
Molecular Properties
| Compound Name | N-ethyl-4,4,4-trifluoro-3-methylsulfanyl-N-(1-pyridin-3-ylpyrazol-4-yl)butanamide |
| PubChem CID | 69262153 |
| Molecular Formula | C15H17F3N4OS |
| Molecular Weight | 358.39 g/mol |
| Exact Mass | 358.11 |
| IUPAC Name | N-ethyl-4,4,4-trifluoro-3-methylsulfanyl-N-(1-pyridin-3-ylpyrazol-4-yl)butanamide |
| SMILES | CCN(C(=O)CC(SC)C(F)(F)F)c1cnn(-c2cccnc2)c1 |
| InChI | InChI=1S/C15H17F3N4OS/c1-3-21(14(23)7-13(24-2)15(16,17)18)12-9-20-22(10-12)11-5-4-6-19-8-11/h4-6,8-10,13H,3,7H2,1-2H3 |
| InChIKey | HDSZTYXOONFCIQ-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.39 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-ethyl-4,4,4-trifluoro-3-methylsulfanyl-N-(1-pyridin-3-ylpyrazol-4-yl)butanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-4,4,4-trifluoro-3-methylsulfanyl-N-(1-pyridin-3-ylpyrazol-4-yl)butanamide?
The IUPAC name of N-ethyl-4,4,4-trifluoro-3-methylsulfanyl-N-(1-pyridin-3-ylpyrazol-4-yl)butanamide (CID 69262153) is N-ethyl-4,4,4-trifluoro-3-methylsulfanyl-N-(1-pyridin-3-ylpyrazol-4-yl)butanamide.
What is the SMILES notation for N-ethyl-4,4,4-trifluoro-3-methylsulfanyl-N-(1-pyridin-3-ylpyrazol-4-yl)butanamide?
The canonical SMILES for N-ethyl-4,4,4-trifluoro-3-methylsulfanyl-N-(1-pyridin-3-ylpyrazol-4-yl)butanamide is CCN(C(=O)CC(SC)C(F)(F)F)c1cnn(-c2cccnc2)c1.
What is the InChIKey of N-ethyl-4,4,4-trifluoro-3-methylsulfanyl-N-(1-pyridin-3-ylpyrazol-4-yl)butanamide?
The InChIKey is HDSZTYXOONFCIQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17F3N4OS/c1-3-21(14(23)7-13(24-2)15(16,17)18)12-9-20-22(10-12)11-5-4-6-19-8-11/h4-6,8-10,13H,3,7H2,1-2H3.
What are the key properties of N-ethyl-4,4,4-trifluoro-3-methylsulfanyl-N-(1-pyridin-3-ylpyrazol-4-yl)butanamide?
N-ethyl-4,4,4-trifluoro-3-methylsulfanyl-N-(1-pyridin-3-ylpyrazol-4-yl)butanamide has a molecular weight of 358.39 g/mol, XLogP of 3.30, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-4,4,4-trifluoro-3-methylsulfanyl-N-(1-pyridin-3-ylpyrazol-4-yl)butanamide is sourced from PubChem (CID 69262153), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).