C23H30ClN5O — CID 69262519
[2-[3-(4-chloro-3-methylanilino)propyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(4,6-dimethylpyrimidin-5-yl)methanone (PubChem CID 69262519) has the molecular formula C23H30ClN5O and a molecular weight of 427.98 g/mol. Its IUPAC name is [2-[3-(4-chloro-3-methylanilino)propyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(4,6-dimethylpyrimidin-5-yl)methanone.
| Compound Name | [2-[3-(4-chloro-3-methylanilino)propyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(4,6-dimethylpyrimidin-5-yl)methanone |
|---|---|
| PubChem CID | 69262519 |
| Molecular Formula | C23H30ClN5O |
| Molecular Weight | 427.98 g/mol |
| Exact Mass | 427.21 |
| IUPAC Name | [2-[3-(4-chloro-3-methylanilino)propyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(4,6-dimethylpyrimidin-5-yl)methanone |
| SMILES | Cc1cc(NCCCN2CC3CN(C(=O)c4c(C)ncnc4C)CC3C2)ccc1Cl |
| InChI | InChI=1S/C23H30ClN5O/c1-15-9-20(5-6-21(15)24)25-7-4-8-28-10-18-12-29(13-19(18)11-28)23(30)22-16(2)26-14-27-17(22)3/h5-6,9,14,18-19,25H,4,7-8,10-13H2,1-3H3 |
| InChIKey | GMXSZLOXPOGPLB-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.98 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|