About [1-(4,4-difluorocyclohexyl)-1-hydroxypropan-2-yl]carbamic acid
[1-(4,4-difluorocyclohexyl)-1-hydroxypropan-2-yl]carbamic acid (PubChem CID 69262808) has the molecular formula C10H17F2NO3
and a molecular weight of 237.25 g/mol. Its IUPAC name is [1-(4,4-difluorocyclohexyl)-1-hydroxypropan-2-yl]carbamic acid.
Molecular Properties
| Compound Name | [1-(4,4-difluorocyclohexyl)-1-hydroxypropan-2-yl]carbamic acid |
| PubChem CID | 69262808 |
| Molecular Formula | C10H17F2NO3 |
| Molecular Weight | 237.25 g/mol |
| Exact Mass | 237.12 |
| IUPAC Name | [1-(4,4-difluorocyclohexyl)-1-hydroxypropan-2-yl]carbamic acid |
| SMILES | CC(NC(=O)O)C(O)C1CCC(F)(F)CC1 |
| InChI | InChI=1S/C10H17F2NO3/c1-6(13-9(15)16)8(14)7-2-4-10(11,12)5-3-7/h6-8,13-14H,2-5H2,1H3,(H,15,16) |
| InChIKey | SVKCTTPZURTUMX-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.25 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [1-(4,4-difluorocyclohexyl)-1-hydroxypropan-2-yl]carbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(4,4-difluorocyclohexyl)-1-hydroxypropan-2-yl]carbamic acid?
The IUPAC name of [1-(4,4-difluorocyclohexyl)-1-hydroxypropan-2-yl]carbamic acid (CID 69262808) is [1-(4,4-difluorocyclohexyl)-1-hydroxypropan-2-yl]carbamic acid.
What is the SMILES notation for [1-(4,4-difluorocyclohexyl)-1-hydroxypropan-2-yl]carbamic acid?
The canonical SMILES for [1-(4,4-difluorocyclohexyl)-1-hydroxypropan-2-yl]carbamic acid is CC(NC(=O)O)C(O)C1CCC(F)(F)CC1.
What is the InChIKey of [1-(4,4-difluorocyclohexyl)-1-hydroxypropan-2-yl]carbamic acid?
The InChIKey is SVKCTTPZURTUMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17F2NO3/c1-6(13-9(15)16)8(14)7-2-4-10(11,12)5-3-7/h6-8,13-14H,2-5H2,1H3,(H,15,16).
What are the key properties of [1-(4,4-difluorocyclohexyl)-1-hydroxypropan-2-yl]carbamic acid?
[1-(4,4-difluorocyclohexyl)-1-hydroxypropan-2-yl]carbamic acid has a molecular weight of 237.25 g/mol, XLogP of 1.83, 3 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(4,4-difluorocyclohexyl)-1-hydroxypropan-2-yl]carbamic acid is sourced from PubChem (CID 69262808), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).