C19H29FN4O3 — CID 69263523
7-[(2S,3S,4R,5R)-4-butoxy-5-(butoxymethyl)-3-fluorooxolan-2-yl]pyrrolo[2,1-f][1,2,4]triazin-4-amine (PubChem CID 69263523) has the molecular formula C19H29FN4O3 and a molecular weight of 380.46 g/mol. Its IUPAC name is 7-[(2S,3S,4R,5R)-4-butoxy-5-(butoxymethyl)-3-fluorooxolan-2-yl]pyrrolo[2,1-f][1,2,4]triazin-4-amine.
| Compound Name | 7-[(2S,3S,4R,5R)-4-butoxy-5-(butoxymethyl)-3-fluorooxolan-2-yl]pyrrolo[2,1-f][1,2,4]triazin-4-amine |
|---|---|
| PubChem CID | 69263523 |
| Molecular Formula | C19H29FN4O3 |
| Molecular Weight | 380.46 g/mol |
| Exact Mass | 380.22 |
| IUPAC Name | 7-[(2S,3S,4R,5R)-4-butoxy-5-(butoxymethyl)-3-fluorooxolan-2-yl]pyrrolo[2,1-f][1,2,4]triazin-4-amine |
| SMILES | CCCCOC[C@H]1O[C@@H](c2ccc3c(N)ncnn23)[C@H](F)[C@@H]1OCCCC |
| InChI | InChI=1S/C19H29FN4O3/c1-3-5-9-25-11-15-18(26-10-6-4-2)16(20)17(27-15)13-7-8-14-19(21)22-12-23-24(13)14/h7-8,12,15-18H,3-6,9-11H2,1-2H3,(H2,21,22,23)/t15-,16+,17+,18-/m1/s1 |
| InChIKey | WJDJWIFEXILRPZ-VSZNYVQBSA-N |
| XLogP | 3.09 |
| TPSA | 83.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.46 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|