C15H28NO4+ — CID 6926390
[(1R,8R)-1,2,3,4,5,6,7,8-octahydropyrrolizin-4-ium-1-yl]methyl (2R)-2-hydroxy-2-[(1S)-1-hydroxyethyl]-3-methylbutanoate (PubChem CID 6926390) has the molecular formula C15H28NO4+ and a molecular weight of 286.39 g/mol. Its IUPAC name is [(1R,8R)-1,2,3,4,5,6,7,8-octahydropyrrolizin-4-ium-1-yl]methyl (2R)-2-hydroxy-2-[(1S)-1-hydroxyethyl]-3-methylbutanoate.
| Compound Name | [(1R,8R)-1,2,3,4,5,6,7,8-octahydropyrrolizin-4-ium-1-yl]methyl (2R)-2-hydroxy-2-[(1S)-1-hydroxyethyl]-3-methylbutanoate |
|---|---|
| PubChem CID | 6926390 |
| Molecular Formula | C15H28NO4+ |
| Molecular Weight | 286.39 g/mol |
| Exact Mass | 286.20 |
| IUPAC Name | [(1R,8R)-1,2,3,4,5,6,7,8-octahydropyrrolizin-4-ium-1-yl]methyl (2R)-2-hydroxy-2-[(1S)-1-hydroxyethyl]-3-methylbutanoate |
| SMILES | CC(C)[C@](O)(C(=O)OC[C@@H]1CC[NH+]2CCC[C@H]12)[C@H](C)O |
| InChI | InChI=1S/C15H27NO4/c1-10(2)15(19,11(3)17)14(18)20-9-12-6-8-16-7-4-5-13(12)16/h10-13,17,19H,4-9H2,1-3H3/p+1/t11-,12-,13+,15+/m0/s1 |
| InChIKey | BWQSLRZZOVFVHJ-RMRHIDDWSA-O |
| XLogP | -0.64 |
| TPSA | 71.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.39 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |