C23H28N4O7 — CID 69264166
N-[3,5-bis(2-ethoxyethoxy)phenyl]-2-(7-nitrobenzimidazol-1-yl)acetamide (PubChem CID 69264166) has the molecular formula C23H28N4O7 and a molecular weight of 472.50 g/mol. Its IUPAC name is N-[3,5-bis(2-ethoxyethoxy)phenyl]-2-(7-nitrobenzimidazol-1-yl)acetamide.
| Compound Name | N-[3,5-bis(2-ethoxyethoxy)phenyl]-2-(7-nitrobenzimidazol-1-yl)acetamide |
|---|---|
| PubChem CID | 69264166 |
| Molecular Formula | C23H28N4O7 |
| Molecular Weight | 472.50 g/mol |
| Exact Mass | 472.20 |
| IUPAC Name | N-[3,5-bis(2-ethoxyethoxy)phenyl]-2-(7-nitrobenzimidazol-1-yl)acetamide |
| SMILES | CCOCCOc1cc(NC(=O)Cn2cnc3cccc([N+](=O)[O-])c32)cc(OCCOCC)c1 |
| InChI | InChI=1S/C23H28N4O7/c1-3-31-8-10-33-18-12-17(13-19(14-18)34-11-9-32-4-2)25-22(28)15-26-16-24-20-6-5-7-21(23(20)26)27(29)30/h5-7,12-14,16H,3-4,8-11,15H2,1-2H3,(H,25,28) |
| InChIKey | CKVSBPODLAQNHE-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 126.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.50 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|