C22H38N4O4S — CID 69264193
ethyl 2-[(3-methyl-2,6-dioxo-1,7-dipentyl-4,5-dihydropurin-8-yl)sulfanyl]butanoate (PubChem CID 69264193) has the molecular formula C22H38N4O4S and a molecular weight of 454.64 g/mol. Its IUPAC name is ethyl 2-[(3-methyl-2,6-dioxo-1,7-dipentyl-4,5-dihydropurin-8-yl)sulfanyl]butanoate.
| Compound Name | ethyl 2-[(3-methyl-2,6-dioxo-1,7-dipentyl-4,5-dihydropurin-8-yl)sulfanyl]butanoate |
|---|---|
| PubChem CID | 69264193 |
| Molecular Formula | C22H38N4O4S |
| Molecular Weight | 454.64 g/mol |
| Exact Mass | 454.26 |
| IUPAC Name | ethyl 2-[(3-methyl-2,6-dioxo-1,7-dipentyl-4,5-dihydropurin-8-yl)sulfanyl]butanoate |
| SMILES | CCCCCN1C(=O)C2C(N=C(SC(CC)C(=O)OCC)N2CCCCC)N(C)C1=O |
| InChI | InChI=1S/C22H38N4O4S/c1-6-10-12-14-25-17-18(23-21(25)31-16(8-3)20(28)30-9-4)24(5)22(29)26(19(17)27)15-13-11-7-2/h16-18H,6-15H2,1-5H3 |
| InChIKey | IYFKTKGQOLLADM-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 82.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.64 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|