C12H14O3 — CID 69264335
4a,5,6,6a,9a,9b-hexahydro-4H-cyclopenta[h]chromene-3,7-dione (PubChem CID 69264335) has the molecular formula C12H14O3 and a molecular weight of 206.24 g/mol. Its IUPAC name is 4a,5,6,6a,9a,9b-hexahydro-4H-cyclopenta[h]chromene-3,7-dione.
| Compound Name | 4a,5,6,6a,9a,9b-hexahydro-4H-cyclopenta[h]chromene-3,7-dione |
|---|---|
| PubChem CID | 69264335 |
| Molecular Formula | C12H14O3 |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.09 |
| IUPAC Name | 4a,5,6,6a,9a,9b-hexahydro-4H-cyclopenta[h]chromene-3,7-dione |
| SMILES | O=C1COC2C(CCC3C(=O)C=CC32)C1 |
| InChI | InChI=1S/C12H14O3/c13-8-5-7-1-2-9-10(3-4-11(9)14)12(7)15-6-8/h3-4,7,9-10,12H,1-2,5-6H2 |
| InChIKey | DLEPMULMQXXQCE-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |