C18H19N3O4 — CID 69264462
2-amino-2-[3-(4-benzamidophenyl)propanoylamino]acetic acid (PubChem CID 69264462) has the molecular formula C18H19N3O4 and a molecular weight of 341.37 g/mol. Its IUPAC name is 2-amino-2-[3-(4-benzamidophenyl)propanoylamino]acetic acid.
| Compound Name | 2-amino-2-[3-(4-benzamidophenyl)propanoylamino]acetic acid |
|---|---|
| PubChem CID | 69264462 |
| Molecular Formula | C18H19N3O4 |
| Molecular Weight | 341.37 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | 2-amino-2-[3-(4-benzamidophenyl)propanoylamino]acetic acid |
| SMILES | NC(NC(=O)CCc1ccc(NC(=O)c2ccccc2)cc1)C(=O)O |
| InChI | InChI=1S/C18H19N3O4/c19-16(18(24)25)21-15(22)11-8-12-6-9-14(10-7-12)20-17(23)13-4-2-1-3-5-13/h1-7,9-10,16H,8,11,19H2,(H,20,23)(H,21,22)(H,24,25) |
| InChIKey | SIXAUCZCKFYTFY-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 121.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.37 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|