C18H13Cl2N3O3 — CID 69264709
3'-[(2,3-dichlorophenyl)methyl]-5-methylspiro[1H-indole-3,5'-imidazolidine]-2,2',4'-trione (PubChem CID 69264709) has the molecular formula C18H13Cl2N3O3 and a molecular weight of 390.23 g/mol. Its IUPAC name is 3'-[(2,3-dichlorophenyl)methyl]-5-methylspiro[1H-indole-3,5'-imidazolidine]-2,2',4'-trione.
| Compound Name | 3'-[(2,3-dichlorophenyl)methyl]-5-methylspiro[1H-indole-3,5'-imidazolidine]-2,2',4'-trione |
|---|---|
| PubChem CID | 69264709 |
| Molecular Formula | C18H13Cl2N3O3 |
| Molecular Weight | 390.23 g/mol |
| Exact Mass | 389.03 |
| IUPAC Name | 3'-[(2,3-dichlorophenyl)methyl]-5-methylspiro[1H-indole-3,5'-imidazolidine]-2,2',4'-trione |
| SMILES | Cc1ccc2c(c1)C1(NC(=O)N(Cc3cccc(Cl)c3Cl)C1=O)C(=O)N2 |
| InChI | InChI=1S/C18H13Cl2N3O3/c1-9-5-6-13-11(7-9)18(15(24)21-13)16(25)23(17(26)22-18)8-10-3-2-4-12(19)14(10)20/h2-7H,8H2,1H3,(H,21,24)(H,22,26) |
| InChIKey | FQECZBVBMBWYTK-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.23 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|