About 2,7-dibromo-9,9-bis[4-(1-ethoxyethoxy)phenyl]fluorene
2,7-dibromo-9,9-bis[4-(1-ethoxyethoxy)phenyl]fluorene (PubChem CID 69264851) has the molecular formula C33H32Br2O4
and a molecular weight of 652.42 g/mol. Its IUPAC name is 2,7-dibromo-9,9-bis[4-(1-ethoxyethoxy)phenyl]fluorene.
Molecular Properties
| Compound Name | 2,7-dibromo-9,9-bis[4-(1-ethoxyethoxy)phenyl]fluorene |
| PubChem CID | 69264851 |
| Molecular Formula | C33H32Br2O4 |
| Molecular Weight | 652.42 g/mol |
| Exact Mass | 650.07 |
| IUPAC Name | 2,7-dibromo-9,9-bis[4-(1-ethoxyethoxy)phenyl]fluorene |
| SMILES | CCOC(C)Oc1ccc(C2(c3ccc(OC(C)OCC)cc3)c3cc(Br)ccc3-c3ccc(Br)cc32)cc1 |
| InChI | InChI=1S/C33H32Br2O4/c1-5-36-21(3)38-27-13-7-23(8-14-27)33(24-9-15-28(16-10-24)39-22(4)37-6-2)31-19-25(34)11-17-29(31)30-18-12-26(35)20-32(30)33/h7-22H,5-6H2,1-4H3 |
| InChIKey | CGWPZCWAIPKPLX-UHFFFAOYSA-N |
| XLogP | 9.10 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 652.42 |
| LogP ≤ 5 | 9.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2,7-dibromo-9,9-bis[4-(1-ethoxyethoxy)phenyl]fluorene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,7-dibromo-9,9-bis[4-(1-ethoxyethoxy)phenyl]fluorene?
The IUPAC name of 2,7-dibromo-9,9-bis[4-(1-ethoxyethoxy)phenyl]fluorene (CID 69264851) is 2,7-dibromo-9,9-bis[4-(1-ethoxyethoxy)phenyl]fluorene.
What is the SMILES notation for 2,7-dibromo-9,9-bis[4-(1-ethoxyethoxy)phenyl]fluorene?
The canonical SMILES for 2,7-dibromo-9,9-bis[4-(1-ethoxyethoxy)phenyl]fluorene is CCOC(C)Oc1ccc(C2(c3ccc(OC(C)OCC)cc3)c3cc(Br)ccc3-c3ccc(Br)cc32)cc1.
What is the InChIKey of 2,7-dibromo-9,9-bis[4-(1-ethoxyethoxy)phenyl]fluorene?
The InChIKey is CGWPZCWAIPKPLX-UHFFFAOYSA-N. The full InChI is InChI=1S/C33H32Br2O4/c1-5-36-21(3)38-27-13-7-23(8-14-27)33(24-9-15-28(16-10-24)39-22(4)37-6-2)31-19-25(34)11-17-29(31)30-18-12-26(35)20-32(30)33/h7-22H,5-6H2,1-4H3.
What are the key properties of 2,7-dibromo-9,9-bis[4-(1-ethoxyethoxy)phenyl]fluorene?
2,7-dibromo-9,9-bis[4-(1-ethoxyethoxy)phenyl]fluorene has a molecular weight of 652.42 g/mol, XLogP of 9.10, 10 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,7-dibromo-9,9-bis[4-(1-ethoxyethoxy)phenyl]fluorene is sourced from PubChem (CID 69264851), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).