C15H11N3O5S — CID 6926542
[(3S)-3,4-dihydro-2H-[1,3]thiazino[3,2-a]benzimidazol-3-yl] 5-nitrofuran-2-carboxylate (PubChem CID 6926542) has the molecular formula C15H11N3O5S and a molecular weight of 345.34 g/mol. Its IUPAC name is [(3S)-3,4-dihydro-2H-[1,3]thiazino[3,2-a]benzimidazol-3-yl] 5-nitrofuran-2-carboxylate.
| Compound Name | [(3S)-3,4-dihydro-2H-[1,3]thiazino[3,2-a]benzimidazol-3-yl] 5-nitrofuran-2-carboxylate |
|---|---|
| PubChem CID | 6926542 |
| Molecular Formula | C15H11N3O5S |
| Molecular Weight | 345.34 g/mol |
| Exact Mass | 345.04 |
| IUPAC Name | [(3S)-3,4-dihydro-2H-[1,3]thiazino[3,2-a]benzimidazol-3-yl] 5-nitrofuran-2-carboxylate |
| SMILES | O=C(O[C@@H]1CSc2nc3ccccc3n2C1)c1ccc([N+](=O)[O-])o1 |
| InChI | InChI=1S/C15H11N3O5S/c19-14(12-5-6-13(23-12)18(20)21)22-9-7-17-11-4-2-1-3-10(11)16-15(17)24-8-9/h1-6,9H,7-8H2/t9-/m0/s1 |
| InChIKey | RAAQJVMNSFJGLY-VIFPVBQESA-N |
| XLogP | 2.87 |
| TPSA | 100.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.34 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|