About 3-thiatricyclo[5.2.1.02,6]dec-8-ene
3-thiatricyclo[5.2.1.02,6]dec-8-ene (PubChem CID 69265474) has the molecular formula C9H12S
and a molecular weight of 152.26 g/mol. Its IUPAC name is 3-thiatricyclo[5.2.1.02,6]dec-8-ene.
Molecular Properties
| Compound Name | 3-thiatricyclo[5.2.1.02,6]dec-8-ene |
| PubChem CID | 69265474 |
| Molecular Formula | C9H12S |
| Molecular Weight | 152.26 g/mol |
| Exact Mass | 152.07 |
| IUPAC Name | 3-thiatricyclo[5.2.1.02,6]dec-8-ene |
| SMILES | C1=CC2CC1C1CCSC21 |
| InChI | InChI=1S/C9H12S/c1-2-7-5-6(1)8-3-4-10-9(7)8/h1-2,6-9H,3-5H2 |
| InChIKey | JPEAGSDRCXHZOC-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.26 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-thiatricyclo[5.2.1.02,6]dec-8-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-thiatricyclo[5.2.1.02,6]dec-8-ene?
The IUPAC name of 3-thiatricyclo[5.2.1.02,6]dec-8-ene (CID 69265474) is 3-thiatricyclo[5.2.1.02,6]dec-8-ene.
What is the SMILES notation for 3-thiatricyclo[5.2.1.02,6]dec-8-ene?
The canonical SMILES for 3-thiatricyclo[5.2.1.02,6]dec-8-ene is C1=CC2CC1C1CCSC21.
What is the InChIKey of 3-thiatricyclo[5.2.1.02,6]dec-8-ene?
The InChIKey is JPEAGSDRCXHZOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12S/c1-2-7-5-6(1)8-3-4-10-9(7)8/h1-2,6-9H,3-5H2.
What are the key properties of 3-thiatricyclo[5.2.1.02,6]dec-8-ene?
3-thiatricyclo[5.2.1.02,6]dec-8-ene has a molecular weight of 152.26 g/mol, XLogP of 2.31, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-thiatricyclo[5.2.1.02,6]dec-8-ene is sourced from PubChem (CID 69265474), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).