C38H72O6Si2 — CID 69265491
butyl 7-[(4R,5R)-2-acetyloxy-4-[tert-butyl(dimethyl)silyl]oxy-5-[(E,3S)-3-[tert-butyl(dimethyl)silyl]oxyoct-1-enyl]cyclopenten-1-yl]heptanoate (PubChem CID 69265491) has the molecular formula C38H72O6Si2 and a molecular weight of 681.16 g/mol. Its IUPAC name is butyl 7-[(4R,5R)-2-acetyloxy-4-[tert-butyl(dimethyl)silyl]oxy-5-[(E,3S)-3-[tert-butyl(dimethyl)silyl]oxyoct-1-enyl]cyclopenten-1-yl]heptanoate.
| Compound Name | butyl 7-[(4R,5R)-2-acetyloxy-4-[tert-butyl(dimethyl)silyl]oxy-5-[(E,3S)-3-[tert-butyl(dimethyl)silyl]oxyoct-1-enyl]cyclopenten-1-yl]heptanoate |
|---|---|
| PubChem CID | 69265491 |
| Molecular Formula | C38H72O6Si2 |
| Molecular Weight | 681.16 g/mol |
| Exact Mass | 680.49 |
| IUPAC Name | butyl 7-[(4R,5R)-2-acetyloxy-4-[tert-butyl(dimethyl)silyl]oxy-5-[(E,3S)-3-[tert-butyl(dimethyl)silyl]oxyoct-1-enyl]cyclopenten-1-yl]heptanoate |
| SMILES | CCCCC[C@@H](/C=C/[C@@H]1C(CCCCCCC(=O)OCCCC)=C(OC(C)=O)C[C@H]1O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C38H72O6Si2/c1-14-16-20-23-31(43-45(10,11)37(4,5)6)26-27-33-32(24-21-18-19-22-25-36(40)41-28-17-15-2)34(42-30(3)39)29-35(33)44-46(12,13)38(7,8)9/h26-27,31,33,35H,14-25,28-29H2,1-13H3/b27-26+/t31-,33+,35+/m0/s1 |
| InChIKey | MAOIQLLVJBCSJF-GALCIAGZSA-N |
| XLogP | 11.42 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.16 |
| LogP ≤ 5 | 11.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|