C17H12Cl2F3N5O2 — CID 69265641
2-[3-cyano-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-5-(dimethylaminomethylideneamino)pyrazol-4-yl]prop-2-enoic acid (PubChem CID 69265641) has the molecular formula C17H12Cl2F3N5O2 and a molecular weight of 446.22 g/mol. Its IUPAC name is 2-[3-cyano-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-5-(dimethylaminomethylideneamino)pyrazol-4-yl]prop-2-enoic acid.
| Compound Name | 2-[3-cyano-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-5-(dimethylaminomethylideneamino)pyrazol-4-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 69265641 |
| Molecular Formula | C17H12Cl2F3N5O2 |
| Molecular Weight | 446.22 g/mol |
| Exact Mass | 445.03 |
| IUPAC Name | 2-[3-cyano-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-5-(dimethylaminomethylideneamino)pyrazol-4-yl]prop-2-enoic acid |
| SMILES | C=C(C(=O)O)c1c(C#N)nn(-c2c(Cl)cc(C(F)(F)F)cc2Cl)c1N=CN(C)C |
| InChI | InChI=1S/C17H12Cl2F3N5O2/c1-8(16(28)29)13-12(6-23)25-27(15(13)24-7-26(2)3)14-10(18)4-9(5-11(14)19)17(20,21)22/h4-5,7H,1H2,2-3H3,(H,28,29) |
| InChIKey | RTCXXBHSQRBJEZ-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 94.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.22 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|