About ethyl 2-[(2-chlorophenyl)methyl]-3-(5-fluorospiro[1H-2-benzofuran-3,4'-piperidine]-1'-yl)propanoate
ethyl 2-[(2-chlorophenyl)methyl]-3-(5-fluorospiro[1H-2-benzofuran-3,4'-piperidine]-1'-yl)propanoate (PubChem CID 69265730) has the molecular formula C24H27ClFNO3
and a molecular weight of 431.94 g/mol. Its IUPAC name is ethyl 2-[(2-chlorophenyl)methyl]-3-(5-fluorospiro[1H-2-benzofuran-3,4'-piperidine]-1'-yl)propanoate.
Molecular Properties
| Compound Name | ethyl 2-[(2-chlorophenyl)methyl]-3-(5-fluorospiro[1H-2-benzofuran-3,4'-piperidine]-1'-yl)propanoate |
| PubChem CID | 69265730 |
| Molecular Formula | C24H27ClFNO3 |
| Molecular Weight | 431.94 g/mol |
| Exact Mass | 431.17 |
| IUPAC Name | ethyl 2-[(2-chlorophenyl)methyl]-3-(5-fluorospiro[1H-2-benzofuran-3,4'-piperidine]-1'-yl)propanoate |
| SMILES | CCOC(=O)C(Cc1ccccc1Cl)CN1CCC2(CC1)OCc1ccc(F)cc12 |
| InChI | InChI=1S/C24H27ClFNO3/c1-2-29-23(28)19(13-17-5-3-4-6-22(17)25)15-27-11-9-24(10-12-27)21-14-20(26)8-7-18(21)16-30-24/h3-8,14,19H,2,9-13,15-16H2,1H3 |
| InChIKey | YWIDLXLQPMIOCZ-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 431.94 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl 2-[(2-chlorophenyl)methyl]-3-(5-fluorospiro[1H-2-benzofuran-3,4'-piperidine]-1'-yl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[(2-chlorophenyl)methyl]-3-(5-fluorospiro[1H-2-benzofuran-3,4'-piperidine]-1'-yl)propanoate?
The IUPAC name of ethyl 2-[(2-chlorophenyl)methyl]-3-(5-fluorospiro[1H-2-benzofuran-3,4'-piperidine]-1'-yl)propanoate (CID 69265730) is ethyl 2-[(2-chlorophenyl)methyl]-3-(5-fluorospiro[1H-2-benzofuran-3,4'-piperidine]-1'-yl)propanoate.
What is the SMILES notation for ethyl 2-[(2-chlorophenyl)methyl]-3-(5-fluorospiro[1H-2-benzofuran-3,4'-piperidine]-1'-yl)propanoate?
The canonical SMILES for ethyl 2-[(2-chlorophenyl)methyl]-3-(5-fluorospiro[1H-2-benzofuran-3,4'-piperidine]-1'-yl)propanoate is CCOC(=O)C(Cc1ccccc1Cl)CN1CCC2(CC1)OCc1ccc(F)cc12.
What is the InChIKey of ethyl 2-[(2-chlorophenyl)methyl]-3-(5-fluorospiro[1H-2-benzofuran-3,4'-piperidine]-1'-yl)propanoate?
The InChIKey is YWIDLXLQPMIOCZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H27ClFNO3/c1-2-29-23(28)19(13-17-5-3-4-6-22(17)25)15-27-11-9-24(10-12-27)21-14-20(26)8-7-18(21)16-30-24/h3-8,14,19H,2,9-13,15-16H2,1H3.
What are the key properties of ethyl 2-[(2-chlorophenyl)methyl]-3-(5-fluorospiro[1H-2-benzofuran-3,4'-piperidine]-1'-yl)propanoate?
ethyl 2-[(2-chlorophenyl)methyl]-3-(5-fluorospiro[1H-2-benzofuran-3,4'-piperidine]-1'-yl)propanoate has a molecular weight of 431.94 g/mol, XLogP of 4.72, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[(2-chlorophenyl)methyl]-3-(5-fluorospiro[1H-2-benzofuran-3,4'-piperidine]-1'-yl)propanoate is sourced from PubChem (CID 69265730), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).