C16H15ClN2O2S — CID 69266122
2-chloro-4-[(1S,2R,6R,7R)-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]-3-methylbenzonitrile (PubChem CID 69266122) has the molecular formula C16H15ClN2O2S and a molecular weight of 334.83 g/mol. Its IUPAC name is 2-chloro-4-[(1S,2R,6R,7R)-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]-3-methylbenzonitrile.
| Compound Name | 2-chloro-4-[(1S,2R,6R,7R)-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]-3-methylbenzonitrile |
|---|---|
| PubChem CID | 69266122 |
| Molecular Formula | C16H15ClN2O2S |
| Molecular Weight | 334.83 g/mol |
| Exact Mass | 334.05 |
| IUPAC Name | 2-chloro-4-[(1S,2R,6R,7R)-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]-3-methylbenzonitrile |
| SMILES | Cc1c(N2C[C@@H]3[C@@H]([C@@H]4C=C[C@H]3C4)S2(=O)=O)ccc(C#N)c1Cl |
| InChI | InChI=1S/C16H15ClN2O2S/c1-9-14(5-4-12(7-18)15(9)17)19-8-13-10-2-3-11(6-10)16(13)22(19,20)21/h2-5,10-11,13,16H,6,8H2,1H3/t10-,11+,13-,16+/m0/s1 |
| InChIKey | CWYIQLJYVHJVHZ-NGOBNIPXSA-N |
| XLogP | 2.86 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.83 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|