C40H76O6Si2 — CID 69266580
butyl 7-[(4R,5R)-2-acetyloxy-4-[tert-butyl(dimethyl)silyl]oxy-5-[(E,3S,5S)-3-[tert-butyl(dimethyl)silyl]oxy-5-methylnon-1-enyl]cyclopenten-1-yl]heptanoate (PubChem CID 69266580) has the molecular formula C40H76O6Si2 and a molecular weight of 709.21 g/mol. Its IUPAC name is butyl 7-[(4R,5R)-2-acetyloxy-4-[tert-butyl(dimethyl)silyl]oxy-5-[(E,3S,5S)-3-[tert-butyl(dimethyl)silyl]oxy-5-methylnon-1-enyl]cyclopenten-1-yl]heptanoate.
| Compound Name | butyl 7-[(4R,5R)-2-acetyloxy-4-[tert-butyl(dimethyl)silyl]oxy-5-[(E,3S,5S)-3-[tert-butyl(dimethyl)silyl]oxy-5-methylnon-1-enyl]cyclopenten-1-yl]heptanoate |
|---|---|
| PubChem CID | 69266580 |
| Molecular Formula | C40H76O6Si2 |
| Molecular Weight | 709.21 g/mol |
| Exact Mass | 708.52 |
| IUPAC Name | butyl 7-[(4R,5R)-2-acetyloxy-4-[tert-butyl(dimethyl)silyl]oxy-5-[(E,3S,5S)-3-[tert-butyl(dimethyl)silyl]oxy-5-methylnon-1-enyl]cyclopenten-1-yl]heptanoate |
| SMILES | CCCCOC(=O)CCCCCCC1=C(OC(C)=O)C[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1/C=C/[C@H](C[C@@H](C)CCCC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C40H76O6Si2/c1-15-17-23-31(3)29-33(45-47(11,12)39(5,6)7)26-27-35-34(24-21-19-20-22-25-38(42)43-28-18-16-2)36(44-32(4)41)30-37(35)46-48(13,14)40(8,9)10/h26-27,31,33,35,37H,15-25,28-30H2,1-14H3/b27-26+/t31-,33+,35+,37+/m0/s1 |
| InChIKey | UJRAUAMPUQMRHV-CAFMNRRFSA-N |
| XLogP | 12.06 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 709.21 |
| LogP ≤ 5 | 12.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|