About 9-chloropurine;hydrochloride
9-chloropurine;hydrochloride (PubChem CID 69266784) has the molecular formula C5H4Cl2N4
and a molecular weight of 191.02 g/mol. Its IUPAC name is 9-chloropurine;hydrochloride.
Molecular Properties
| Compound Name | 9-chloropurine;hydrochloride |
| PubChem CID | 69266784 |
| Molecular Formula | C5H4Cl2N4 |
| Molecular Weight | 191.02 g/mol |
| Exact Mass | 189.98 |
| IUPAC Name | 9-chloropurine;hydrochloride |
| SMILES | Cl.Cln1cnc2cncnc21 |
| InChI | InChI=1S/C5H3ClN4.ClH/c6-10-3-9-4-1-7-2-8-5(4)10;/h1-3H;1H |
| InChIKey | KKXCFBJDZIJVDK-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.02 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 9-chloropurine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-chloropurine;hydrochloride?
The IUPAC name of 9-chloropurine;hydrochloride (CID 69266784) is 9-chloropurine;hydrochloride.
What is the SMILES notation for 9-chloropurine;hydrochloride?
The canonical SMILES for 9-chloropurine;hydrochloride is Cl.Cln1cnc2cncnc21.
What is the InChIKey of 9-chloropurine;hydrochloride?
The InChIKey is KKXCFBJDZIJVDK-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H3ClN4.ClH/c6-10-3-9-4-1-7-2-8-5(4)10;/h1-3H;1H.
What are the key properties of 9-chloropurine;hydrochloride?
9-chloropurine;hydrochloride has a molecular weight of 191.02 g/mol, XLogP of 1.25, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 9-chloropurine;hydrochloride is sourced from PubChem (CID 69266784), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).