C13H22N2OS — CID 6926701
1-[(1S,2S,4R)-2-bicyclo[2.2.1]hept-5-enyl]-3-(4-hydroxy-2-methylbutan-2-yl)thiourea (PubChem CID 6926701) has the molecular formula C13H22N2OS and a molecular weight of 254.40 g/mol. Its IUPAC name is 1-[(1S,2S,4R)-2-bicyclo[2.2.1]hept-5-enyl]-3-(4-hydroxy-2-methylbutan-2-yl)thiourea.
| Compound Name | 1-[(1S,2S,4R)-2-bicyclo[2.2.1]hept-5-enyl]-3-(4-hydroxy-2-methylbutan-2-yl)thiourea |
|---|---|
| PubChem CID | 6926701 |
| Molecular Formula | C13H22N2OS |
| Molecular Weight | 254.40 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | 1-[(1S,2S,4R)-2-bicyclo[2.2.1]hept-5-enyl]-3-(4-hydroxy-2-methylbutan-2-yl)thiourea |
| SMILES | CC(C)(CCO)NC(=S)N[C@H]1C[C@@H]2C=C[C@@H]1C2 |
| InChI | InChI=1S/C13H22N2OS/c1-13(2,5-6-16)15-12(17)14-11-8-9-3-4-10(11)7-9/h3-4,9-11,16H,5-8H2,1-2H3,(H2,14,15,17)/t9-,10-,11+/m1/s1 |
| InChIKey | BHQXQRWITRWDKM-MXWKQRLJSA-N |
| XLogP | 1.58 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.40 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|