C30H30FN3O3 — CID 69267636
3-(1-benzofuran-7-yl)-4-[4-fluoro-1-[1-(2-methylpropylamino)cyclohexyl]indol-3-yl]pyrrole-2,5-dione (PubChem CID 69267636) has the molecular formula C30H30FN3O3 and a molecular weight of 499.59 g/mol. Its IUPAC name is 3-(1-benzofuran-7-yl)-4-[4-fluoro-1-[1-(2-methylpropylamino)cyclohexyl]indol-3-yl]pyrrole-2,5-dione.
| Compound Name | 3-(1-benzofuran-7-yl)-4-[4-fluoro-1-[1-(2-methylpropylamino)cyclohexyl]indol-3-yl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 69267636 |
| Molecular Formula | C30H30FN3O3 |
| Molecular Weight | 499.59 g/mol |
| Exact Mass | 499.23 |
| IUPAC Name | 3-(1-benzofuran-7-yl)-4-[4-fluoro-1-[1-(2-methylpropylamino)cyclohexyl]indol-3-yl]pyrrole-2,5-dione |
| SMILES | CC(C)CNC1(n2cc(C3=C(c4cccc5ccoc45)C(=O)NC3=O)c3c(F)cccc32)CCCCC1 |
| InChI | InChI=1S/C30H30FN3O3/c1-18(2)16-32-30(13-4-3-5-14-30)34-17-21(24-22(31)10-7-11-23(24)34)26-25(28(35)33-29(26)36)20-9-6-8-19-12-15-37-27(19)20/h6-12,15,17-18,32H,3-5,13-14,16H2,1-2H3,(H,33,35,36) |
| InChIKey | JWJZMIGQQMYPIK-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 76.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.59 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|