C40H76N2O8 — CID 69267645
3,10,10-triethyl-9-hydroxy-8,8-dimethyl-3-[6-[(3,10,10-triethyl-9-hydroxy-8,8-dimethyl-1,5-dioxa-9-azaspiro[5.5]undecan-3-yl)methoxy]hexoxymethyl]-1,5-dioxa-9-azaspiro[5.5]undecane (PubChem CID 69267645) has the molecular formula C40H76N2O8 and a molecular weight of 713.05 g/mol. Its IUPAC name is 3,10,10-triethyl-9-hydroxy-8,8-dimethyl-3-[6-[(3,10,10-triethyl-9-hydroxy-8,8-dimethyl-1,5-dioxa-9-azaspiro[5.5]undecan-3-yl)methoxy]hexoxymethyl]-1,5-dioxa-9-azaspiro[5.5]undecane.
| Compound Name | 3,10,10-triethyl-9-hydroxy-8,8-dimethyl-3-[6-[(3,10,10-triethyl-9-hydroxy-8,8-dimethyl-1,5-dioxa-9-azaspiro[5.5]undecan-3-yl)methoxy]hexoxymethyl]-1,5-dioxa-9-azaspiro[5.5]undecane |
|---|---|
| PubChem CID | 69267645 |
| Molecular Formula | C40H76N2O8 |
| Molecular Weight | 713.05 g/mol |
| Exact Mass | 712.56 |
| IUPAC Name | 3,10,10-triethyl-9-hydroxy-8,8-dimethyl-3-[6-[(3,10,10-triethyl-9-hydroxy-8,8-dimethyl-1,5-dioxa-9-azaspiro[5.5]undecan-3-yl)methoxy]hexoxymethyl]-1,5-dioxa-9-azaspiro[5.5]undecane |
| SMILES | CCC1(COCCCCCCOCC2(CC)COC3(CC(C)(C)N(O)C(CC)(CC)C3)OC2)COC2(CC(C)(C)N(O)C(CC)(CC)C2)OC1 |
| InChI | InChI=1S/C40H76N2O8/c1-11-35(29-47-39(48-30-35)23-33(7,8)41(43)37(13-3,14-4)25-39)27-45-21-19-17-18-20-22-46-28-36(12-2)31-49-40(50-32-36)24-34(9,10)42(44)38(15-5,16-6)26-40/h43-44H,11-32H2,1-10H3 |
| InChIKey | CEEMCPZQIWUMIR-UHFFFAOYSA-N |
| XLogP | 8.50 |
| TPSA | 102.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 713.05 |
| LogP ≤ 5 | 8.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|