C27H35ClN4O3 — CID 69267909
2-(4-chloro-2,6-dimethylanilino)-3-[1-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propanoyl]piperidin-4-yl]propanoic acid (PubChem CID 69267909) has the molecular formula C27H35ClN4O3 and a molecular weight of 499.06 g/mol. Its IUPAC name is 2-(4-chloro-2,6-dimethylanilino)-3-[1-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propanoyl]piperidin-4-yl]propanoic acid.
| Compound Name | 2-(4-chloro-2,6-dimethylanilino)-3-[1-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propanoyl]piperidin-4-yl]propanoic acid |
|---|---|
| PubChem CID | 69267909 |
| Molecular Formula | C27H35ClN4O3 |
| Molecular Weight | 499.06 g/mol |
| Exact Mass | 498.24 |
| IUPAC Name | 2-(4-chloro-2,6-dimethylanilino)-3-[1-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propanoyl]piperidin-4-yl]propanoic acid |
| SMILES | Cc1cc(Cl)cc(C)c1NC(CC1CCN(C(=O)CCc2ccc3c(n2)NCCC3)CC1)C(=O)O |
| InChI | InChI=1S/C27H35ClN4O3/c1-17-14-21(28)15-18(2)25(17)31-23(27(34)35)16-19-9-12-32(13-10-19)24(33)8-7-22-6-5-20-4-3-11-29-26(20)30-22/h5-6,14-15,19,23,31H,3-4,7-13,16H2,1-2H3,(H,29,30)(H,34,35) |
| InChIKey | DIAVFQUISSWSFR-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 94.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.06 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |