3-phenylfuro[3,2-c]pyridine-2-carboxylic acid

C14H9NO3 — CID 69268109

IUPAC3-phenylfuro[3,2-c]pyridine-2-carboxylic acid
SMILESO=C(O)c1oc2ccncc2c1-c1ccccc1
InChIInChI=1S/C14H9NO3/c16-14(17)13-12(9-4-2-1-3-5-9)10-8-15-7-6-11(10)18-13/h1-8H,(H,16,17)
InChIKeyUBAMWLRJAPBPNJ-UHFFFAOYSA-N
MW239.23 g/mol
LogP3.19
Rot. Bonds2

About 3-phenylfuro[3,2-c]pyridine-2-carboxylic acid

3-phenylfuro[3,2-c]pyridine-2-carboxylic acid (PubChem CID 69268109) has the molecular formula C14H9NO3 and a molecular weight of 239.23 g/mol. Its IUPAC name is 3-phenylfuro[3,2-c]pyridine-2-carboxylic acid.

Molecular Properties

Compound Name3-phenylfuro[3,2-c]pyridine-2-carboxylic acid
PubChem CID69268109
Molecular FormulaC14H9NO3
Molecular Weight239.23 g/mol
Exact Mass239.06
IUPAC Name3-phenylfuro[3,2-c]pyridine-2-carboxylic acid
SMILESO=C(O)c1oc2ccncc2c1-c1ccccc1
InChIInChI=1S/C14H9NO3/c16-14(17)13-12(9-4-2-1-3-5-9)10-8-15-7-6-11(10)18-13/h1-8H,(H,16,17)
InChIKeyUBAMWLRJAPBPNJ-UHFFFAOYSA-N
XLogP3.19
TPSA63.33 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500239.23
LogP ≤ 53.19
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 3-phenylfuro[3,2-c]pyridine-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-phenylfuro[3,2-c]pyridine-2-carboxylic acid?
The IUPAC name of 3-phenylfuro[3,2-c]pyridine-2-carboxylic acid (CID 69268109) is 3-phenylfuro[3,2-c]pyridine-2-carboxylic acid.
What is the SMILES notation for 3-phenylfuro[3,2-c]pyridine-2-carboxylic acid?
The canonical SMILES for 3-phenylfuro[3,2-c]pyridine-2-carboxylic acid is O=C(O)c1oc2ccncc2c1-c1ccccc1.
What is the InChIKey of 3-phenylfuro[3,2-c]pyridine-2-carboxylic acid?
The InChIKey is UBAMWLRJAPBPNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H9NO3/c16-14(17)13-12(9-4-2-1-3-5-9)10-8-15-7-6-11(10)18-13/h1-8H,(H,16,17).
What are the key properties of 3-phenylfuro[3,2-c]pyridine-2-carboxylic acid?
3-phenylfuro[3,2-c]pyridine-2-carboxylic acid has a molecular weight of 239.23 g/mol, XLogP of 3.19, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-phenylfuro[3,2-c]pyridine-2-carboxylic acid is sourced from PubChem (CID 69268109), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).