About 3-phenylfuro[3,2-c]pyridine-2-carboxylic acid
3-phenylfuro[3,2-c]pyridine-2-carboxylic acid (PubChem CID 69268109) has the molecular formula C14H9NO3
and a molecular weight of 239.23 g/mol. Its IUPAC name is 3-phenylfuro[3,2-c]pyridine-2-carboxylic acid.
Molecular Properties
| Compound Name | 3-phenylfuro[3,2-c]pyridine-2-carboxylic acid |
| PubChem CID | 69268109 |
| Molecular Formula | C14H9NO3 |
| Molecular Weight | 239.23 g/mol |
| Exact Mass | 239.06 |
| IUPAC Name | 3-phenylfuro[3,2-c]pyridine-2-carboxylic acid |
| SMILES | O=C(O)c1oc2ccncc2c1-c1ccccc1 |
| InChI | InChI=1S/C14H9NO3/c16-14(17)13-12(9-4-2-1-3-5-9)10-8-15-7-6-11(10)18-13/h1-8H,(H,16,17) |
| InChIKey | UBAMWLRJAPBPNJ-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.23 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-phenylfuro[3,2-c]pyridine-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-phenylfuro[3,2-c]pyridine-2-carboxylic acid?
The IUPAC name of 3-phenylfuro[3,2-c]pyridine-2-carboxylic acid (CID 69268109) is 3-phenylfuro[3,2-c]pyridine-2-carboxylic acid.
What is the SMILES notation for 3-phenylfuro[3,2-c]pyridine-2-carboxylic acid?
The canonical SMILES for 3-phenylfuro[3,2-c]pyridine-2-carboxylic acid is O=C(O)c1oc2ccncc2c1-c1ccccc1.
What is the InChIKey of 3-phenylfuro[3,2-c]pyridine-2-carboxylic acid?
The InChIKey is UBAMWLRJAPBPNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H9NO3/c16-14(17)13-12(9-4-2-1-3-5-9)10-8-15-7-6-11(10)18-13/h1-8H,(H,16,17).
What are the key properties of 3-phenylfuro[3,2-c]pyridine-2-carboxylic acid?
3-phenylfuro[3,2-c]pyridine-2-carboxylic acid has a molecular weight of 239.23 g/mol, XLogP of 3.19, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-phenylfuro[3,2-c]pyridine-2-carboxylic acid is sourced from PubChem (CID 69268109), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).