C13H12Br2O3 — CID 69268161
(1R,2R,4R)-4-bromo-2-(2-bromophenyl)-5-oxocyclohexane-1-carboxylic acid (PubChem CID 69268161) has the molecular formula C13H12Br2O3 and a molecular weight of 376.04 g/mol. Its IUPAC name is (1R,2R,4R)-4-bromo-2-(2-bromophenyl)-5-oxocyclohexane-1-carboxylic acid.
| Compound Name | (1R,2R,4R)-4-bromo-2-(2-bromophenyl)-5-oxocyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 69268161 |
| Molecular Formula | C13H12Br2O3 |
| Molecular Weight | 376.04 g/mol |
| Exact Mass | 373.92 |
| IUPAC Name | (1R,2R,4R)-4-bromo-2-(2-bromophenyl)-5-oxocyclohexane-1-carboxylic acid |
| SMILES | O=C1C[C@@H](C(=O)O)[C@H](c2ccccc2Br)C[C@H]1Br |
| InChI | InChI=1S/C13H12Br2O3/c14-10-4-2-1-3-7(10)8-5-11(15)12(16)6-9(8)13(17)18/h1-4,8-9,11H,5-6H2,(H,17,18)/t8-,9+,11+/m0/s1 |
| InChIKey | VYBUBZKLLSGMIM-IQJOONFLSA-N |
| XLogP | 3.36 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.04 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|