C27H27N5O2 — CID 69268622
3-imidazo[1,2-a]pyridin-3-yl-4-[1-(1-propan-2-ylpiperidin-4-yl)indol-3-yl]pyrrole-2,5-dione (PubChem CID 69268622) has the molecular formula C27H27N5O2 and a molecular weight of 453.55 g/mol. Its IUPAC name is 3-imidazo[1,2-a]pyridin-3-yl-4-[1-(1-propan-2-ylpiperidin-4-yl)indol-3-yl]pyrrole-2,5-dione.
| Compound Name | 3-imidazo[1,2-a]pyridin-3-yl-4-[1-(1-propan-2-ylpiperidin-4-yl)indol-3-yl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 69268622 |
| Molecular Formula | C27H27N5O2 |
| Molecular Weight | 453.55 g/mol |
| Exact Mass | 453.22 |
| IUPAC Name | 3-imidazo[1,2-a]pyridin-3-yl-4-[1-(1-propan-2-ylpiperidin-4-yl)indol-3-yl]pyrrole-2,5-dione |
| SMILES | CC(C)N1CCC(n2cc(C3=C(c4cnc5ccccn45)C(=O)NC3=O)c3ccccc32)CC1 |
| InChI | InChI=1S/C27H27N5O2/c1-17(2)30-13-10-18(11-14-30)32-16-20(19-7-3-4-8-21(19)32)24-25(27(34)29-26(24)33)22-15-28-23-9-5-6-12-31(22)23/h3-9,12,15-18H,10-11,13-14H2,1-2H3,(H,29,33,34) |
| InChIKey | PBZIQFOLVDISLG-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 71.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.55 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|