About (1S)-1-(4-bromophenyl)-2,2-difluoroethanol
(1S)-1-(4-bromophenyl)-2,2-difluoroethanol (PubChem CID 69269398) has the molecular formula C8H7BrF2O
and a molecular weight of 237.04 g/mol. Its IUPAC name is (1S)-1-(4-bromophenyl)-2,2-difluoroethanol.
Molecular Properties
| Compound Name | (1S)-1-(4-bromophenyl)-2,2-difluoroethanol |
| PubChem CID | 69269398 |
| Molecular Formula | C8H7BrF2O |
| Molecular Weight | 237.04 g/mol |
| Exact Mass | 235.96 |
| IUPAC Name | (1S)-1-(4-bromophenyl)-2,2-difluoroethanol |
| SMILES | O[C@@H](c1ccc(Br)cc1)C(F)F |
| InChI | InChI=1S/C8H7BrF2O/c9-6-3-1-5(2-4-6)7(12)8(10)11/h1-4,7-8,12H/t7-/m0/s1 |
| InChIKey | MACLWDXHRYFAPX-ZETCQYMHSA-N |
| XLogP | 2.75 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.04 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (1S)-1-(4-bromophenyl)-2,2-difluoroethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S)-1-(4-bromophenyl)-2,2-difluoroethanol?
The IUPAC name of (1S)-1-(4-bromophenyl)-2,2-difluoroethanol (CID 69269398) is (1S)-1-(4-bromophenyl)-2,2-difluoroethanol.
What is the SMILES notation for (1S)-1-(4-bromophenyl)-2,2-difluoroethanol?
The canonical SMILES for (1S)-1-(4-bromophenyl)-2,2-difluoroethanol is O[C@@H](c1ccc(Br)cc1)C(F)F.
What is the InChIKey of (1S)-1-(4-bromophenyl)-2,2-difluoroethanol?
The InChIKey is MACLWDXHRYFAPX-ZETCQYMHSA-N. The full InChI is InChI=1S/C8H7BrF2O/c9-6-3-1-5(2-4-6)7(12)8(10)11/h1-4,7-8,12H/t7-/m0/s1.
What are the key properties of (1S)-1-(4-bromophenyl)-2,2-difluoroethanol?
(1S)-1-(4-bromophenyl)-2,2-difluoroethanol has a molecular weight of 237.04 g/mol, XLogP of 2.75, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1S)-1-(4-bromophenyl)-2,2-difluoroethanol is sourced from PubChem (CID 69269398), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).