C37H32N2O2 — CID 69269481
[(1S)-1-phenylethyl] (4R,5S)-3-benzyl-2,4,5-triphenyl-4H-imidazole-5-carboxylate (PubChem CID 69269481) has the molecular formula C37H32N2O2 and a molecular weight of 536.68 g/mol. Its IUPAC name is [(1S)-1-phenylethyl] (4R,5S)-3-benzyl-2,4,5-triphenyl-4H-imidazole-5-carboxylate.
| Compound Name | [(1S)-1-phenylethyl] (4R,5S)-3-benzyl-2,4,5-triphenyl-4H-imidazole-5-carboxylate |
|---|---|
| PubChem CID | 69269481 |
| Molecular Formula | C37H32N2O2 |
| Molecular Weight | 536.68 g/mol |
| Exact Mass | 536.25 |
| IUPAC Name | [(1S)-1-phenylethyl] (4R,5S)-3-benzyl-2,4,5-triphenyl-4H-imidazole-5-carboxylate |
| SMILES | C[C@H](OC(=O)[C@@]1(c2ccccc2)N=C(c2ccccc2)N(Cc2ccccc2)[C@@H]1c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C37H32N2O2/c1-28(30-19-9-3-10-20-30)41-36(40)37(33-25-15-6-16-26-33)34(31-21-11-4-12-22-31)39(27-29-17-7-2-8-18-29)35(38-37)32-23-13-5-14-24-32/h2-26,28,34H,27H2,1H3/t28-,34+,37-/m0/s1 |
| InChIKey | NQJZNHXMDZJTDK-ZEFJTTDVSA-N |
| XLogP | 7.89 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.68 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |