C28H33N9 — CID 69269522
3-N-[4-[4-(2-bicyclo[2.2.1]heptanyl)piperazin-1-yl]phenyl]-1-(2-methylquinazolin-4-yl)-1,2,4-triazole-3,5-diamine (PubChem CID 69269522) has the molecular formula C28H33N9 and a molecular weight of 495.64 g/mol. Its IUPAC name is 3-N-[4-[4-(2-bicyclo[2.2.1]heptanyl)piperazin-1-yl]phenyl]-1-(2-methylquinazolin-4-yl)-1,2,4-triazole-3,5-diamine.
| Compound Name | 3-N-[4-[4-(2-bicyclo[2.2.1]heptanyl)piperazin-1-yl]phenyl]-1-(2-methylquinazolin-4-yl)-1,2,4-triazole-3,5-diamine |
|---|---|
| PubChem CID | 69269522 |
| Molecular Formula | C28H33N9 |
| Molecular Weight | 495.64 g/mol |
| Exact Mass | 495.29 |
| IUPAC Name | 3-N-[4-[4-(2-bicyclo[2.2.1]heptanyl)piperazin-1-yl]phenyl]-1-(2-methylquinazolin-4-yl)-1,2,4-triazole-3,5-diamine |
| SMILES | Cc1nc(-n2nc(Nc3ccc(N4CCN(C5CC6CCC5C6)CC4)cc3)nc2N)c2ccccc2n1 |
| InChI | InChI=1S/C28H33N9/c1-18-30-24-5-3-2-4-23(24)26(31-18)37-27(29)33-28(34-37)32-21-8-10-22(11-9-21)35-12-14-36(15-13-35)25-17-19-6-7-20(25)16-19/h2-5,8-11,19-20,25H,6-7,12-17H2,1H3,(H3,29,32,33,34) |
| InChIKey | GQYBICVRUVAWPG-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 101.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.64 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|