C19H24FNO7 — CID 69270933
[(3aR,5R,6S,6aR)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] N-(4-fluorophenyl)carbamate (PubChem CID 69270933) has the molecular formula C19H24FNO7 and a molecular weight of 397.40 g/mol. Its IUPAC name is [(3aR,5R,6S,6aR)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] N-(4-fluorophenyl)carbamate.
| Compound Name | [(3aR,5R,6S,6aR)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] N-(4-fluorophenyl)carbamate |
|---|---|
| PubChem CID | 69270933 |
| Molecular Formula | C19H24FNO7 |
| Molecular Weight | 397.40 g/mol |
| Exact Mass | 397.15 |
| IUPAC Name | [(3aR,5R,6S,6aR)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] N-(4-fluorophenyl)carbamate |
| SMILES | CC1(C)O[C@H]2O[C@H]([C@H]3COC(C)(C)O3)[C@H](OC(=O)Nc3ccc(F)cc3)[C@H]2O1 |
| InChI | InChI=1S/C19H24FNO7/c1-18(2)23-9-12(26-18)13-14(15-16(24-13)28-19(3,4)27-15)25-17(22)21-11-7-5-10(20)6-8-11/h5-8,12-16H,9H2,1-4H3,(H,21,22)/t12-,13-,14+,15-,16-/m1/s1 |
| InChIKey | PDGMNDCXYUAHEL-IBEHDNSVSA-N |
| XLogP | 2.77 |
| TPSA | 84.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.40 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |