About [(2S,3S)-3-[tert-butyl(dimethyl)silyl]oxy-4-(3-fluorophenyl)-4-hydroxybutan-2-yl]carbamic acid
[(2S,3S)-3-[tert-butyl(dimethyl)silyl]oxy-4-(3-fluorophenyl)-4-hydroxybutan-2-yl]carbamic acid (PubChem CID 69271337) has the molecular formula C17H28FNO4Si
and a molecular weight of 357.50 g/mol. Its IUPAC name is [(2S,3S)-3-[tert-butyl(dimethyl)silyl]oxy-4-(3-fluorophenyl)-4-hydroxybutan-2-yl]carbamic acid.
Molecular Properties
| Compound Name | [(2S,3S)-3-[tert-butyl(dimethyl)silyl]oxy-4-(3-fluorophenyl)-4-hydroxybutan-2-yl]carbamic acid |
| PubChem CID | 69271337 |
| Molecular Formula | C17H28FNO4Si |
| Molecular Weight | 357.50 g/mol |
| Exact Mass | 357.18 |
| IUPAC Name | [(2S,3S)-3-[tert-butyl(dimethyl)silyl]oxy-4-(3-fluorophenyl)-4-hydroxybutan-2-yl]carbamic acid |
| SMILES | C[C@H](NC(=O)O)[C@H](O[Si](C)(C)C(C)(C)C)C(O)c1cccc(F)c1 |
| InChI | InChI=1S/C17H28FNO4Si/c1-11(19-16(21)22)15(23-24(5,6)17(2,3)4)14(20)12-8-7-9-13(18)10-12/h7-11,14-15,19-20H,1-6H3,(H,21,22)/t11-,14?,15-/m0/s1 |
| InChIKey | FBVFVIXHZPDFPU-NGKXAEKTSA-N |
| XLogP | 3.91 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.50 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [(2S,3S)-3-[tert-butyl(dimethyl)silyl]oxy-4-(3-fluorophenyl)-4-hydroxybutan-2-yl]carbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S,3S)-3-[tert-butyl(dimethyl)silyl]oxy-4-(3-fluorophenyl)-4-hydroxybutan-2-yl]carbamic acid?
The IUPAC name of [(2S,3S)-3-[tert-butyl(dimethyl)silyl]oxy-4-(3-fluorophenyl)-4-hydroxybutan-2-yl]carbamic acid (CID 69271337) is [(2S,3S)-3-[tert-butyl(dimethyl)silyl]oxy-4-(3-fluorophenyl)-4-hydroxybutan-2-yl]carbamic acid.
What is the SMILES notation for [(2S,3S)-3-[tert-butyl(dimethyl)silyl]oxy-4-(3-fluorophenyl)-4-hydroxybutan-2-yl]carbamic acid?
The canonical SMILES for [(2S,3S)-3-[tert-butyl(dimethyl)silyl]oxy-4-(3-fluorophenyl)-4-hydroxybutan-2-yl]carbamic acid is C[C@H](NC(=O)O)[C@H](O[Si](C)(C)C(C)(C)C)C(O)c1cccc(F)c1.
What is the InChIKey of [(2S,3S)-3-[tert-butyl(dimethyl)silyl]oxy-4-(3-fluorophenyl)-4-hydroxybutan-2-yl]carbamic acid?
The InChIKey is FBVFVIXHZPDFPU-NGKXAEKTSA-N. The full InChI is InChI=1S/C17H28FNO4Si/c1-11(19-16(21)22)15(23-24(5,6)17(2,3)4)14(20)12-8-7-9-13(18)10-12/h7-11,14-15,19-20H,1-6H3,(H,21,22)/t11-,14?,15-/m0/s1.
What are the key properties of [(2S,3S)-3-[tert-butyl(dimethyl)silyl]oxy-4-(3-fluorophenyl)-4-hydroxybutan-2-yl]carbamic acid?
[(2S,3S)-3-[tert-butyl(dimethyl)silyl]oxy-4-(3-fluorophenyl)-4-hydroxybutan-2-yl]carbamic acid has a molecular weight of 357.50 g/mol, XLogP of 3.91, 6 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S,3S)-3-[tert-butyl(dimethyl)silyl]oxy-4-(3-fluorophenyl)-4-hydroxybutan-2-yl]carbamic acid is sourced from PubChem (CID 69271337), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).