C27H30FN9 — CID 69272552
3-N-[4-[4-(2-bicyclo[2.2.1]heptanyl)piperazin-1-yl]phenyl]-1-(6-fluoroquinazolin-4-yl)-1,2,4-triazole-3,5-diamine (PubChem CID 69272552) has the molecular formula C27H30FN9 and a molecular weight of 499.60 g/mol. Its IUPAC name is 3-N-[4-[4-(2-bicyclo[2.2.1]heptanyl)piperazin-1-yl]phenyl]-1-(6-fluoroquinazolin-4-yl)-1,2,4-triazole-3,5-diamine.
| Compound Name | 3-N-[4-[4-(2-bicyclo[2.2.1]heptanyl)piperazin-1-yl]phenyl]-1-(6-fluoroquinazolin-4-yl)-1,2,4-triazole-3,5-diamine |
|---|---|
| PubChem CID | 69272552 |
| Molecular Formula | C27H30FN9 |
| Molecular Weight | 499.60 g/mol |
| Exact Mass | 499.26 |
| IUPAC Name | 3-N-[4-[4-(2-bicyclo[2.2.1]heptanyl)piperazin-1-yl]phenyl]-1-(6-fluoroquinazolin-4-yl)-1,2,4-triazole-3,5-diamine |
| SMILES | Nc1nc(Nc2ccc(N3CCN(C4CC5CCC4C5)CC3)cc2)nn1-c1ncnc2ccc(F)cc12 |
| InChI | InChI=1S/C27H30FN9/c28-19-3-8-23-22(15-19)25(31-16-30-23)37-26(29)33-27(34-37)32-20-4-6-21(7-5-20)35-9-11-36(12-10-35)24-14-17-1-2-18(24)13-17/h3-8,15-18,24H,1-2,9-14H2,(H3,29,32,33,34) |
| InChIKey | FJOGCOQDUBZENL-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 101.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.60 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|