C18H25N4OS+ — CID 6927305
4-[(2R,5R)-5-[(4,6-dimethylpyrimidin-2-yl)sulfanylmethyl]-1,3-oxazolidin-3-ium-2-yl]-N,N-dimethylaniline (PubChem CID 6927305) has the molecular formula C18H25N4OS+ and a molecular weight of 345.49 g/mol. Its IUPAC name is 4-[(2R,5R)-5-[(4,6-dimethylpyrimidin-2-yl)sulfanylmethyl]-1,3-oxazolidin-3-ium-2-yl]-N,N-dimethylaniline.
| Compound Name | 4-[(2R,5R)-5-[(4,6-dimethylpyrimidin-2-yl)sulfanylmethyl]-1,3-oxazolidin-3-ium-2-yl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 6927305 |
| Molecular Formula | C18H25N4OS+ |
| Molecular Weight | 345.49 g/mol |
| Exact Mass | 345.17 |
| IUPAC Name | 4-[(2R,5R)-5-[(4,6-dimethylpyrimidin-2-yl)sulfanylmethyl]-1,3-oxazolidin-3-ium-2-yl]-N,N-dimethylaniline |
| SMILES | Cc1cc(C)nc(SC[C@H]2C[NH2+][C@@H](c3ccc(N(C)C)cc3)O2)n1 |
| InChI | InChI=1S/C18H24N4OS/c1-12-9-13(2)21-18(20-12)24-11-16-10-19-17(23-16)14-5-7-15(8-6-14)22(3)4/h5-9,16-17,19H,10-11H2,1-4H3/p+1/t16-,17-/m1/s1 |
| InChIKey | YKMGPLLJVCPUMA-IAGOWNOFSA-O |
| XLogP | 1.91 |
| TPSA | 54.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.49 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|