C24H32O3 — CID 69273240
5-[(8S,9S,10R,13S,14R,17S)-1-hydroxy-10,13-dimethyl-2,3,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]pyran-2-one (PubChem CID 69273240) has the molecular formula C24H32O3 and a molecular weight of 368.52 g/mol. Its IUPAC name is 5-[(8S,9S,10R,13S,14R,17S)-1-hydroxy-10,13-dimethyl-2,3,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]pyran-2-one.
| Compound Name | 5-[(8S,9S,10R,13S,14R,17S)-1-hydroxy-10,13-dimethyl-2,3,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]pyran-2-one |
|---|---|
| PubChem CID | 69273240 |
| Molecular Formula | C24H32O3 |
| Molecular Weight | 368.52 g/mol |
| Exact Mass | 368.24 |
| IUPAC Name | 5-[(8S,9S,10R,13S,14R,17S)-1-hydroxy-10,13-dimethyl-2,3,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]pyran-2-one |
| SMILES | C[C@]12CC[C@H]3[C@@H](CCC4=CCCC(O)[C@@]43C)[C@H]1CC[C@@H]2c1ccc(=O)oc1 |
| InChI | InChI=1S/C24H32O3/c1-23-13-12-20-17(8-7-16-4-3-5-21(25)24(16,20)2)19(23)10-9-18(23)15-6-11-22(26)27-14-15/h4,6,11,14,17-21,25H,3,5,7-10,12-13H2,1-2H3/t17-,18+,19+,20-,21?,23+,24-/m0/s1 |
| InChIKey | VYJQPLFNRREGFA-ZERCPWJUSA-N |
| XLogP | 5.05 |
| TPSA | 50.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.52 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|