C15H23N3O5Si — CID 69274759
(3,4,8b-trimethyl-2,3a-dihydro-1H-pyrrolo[2,3-b]indol-7-yl) N-methylcarbamate;dihydroxy(oxo)silane (PubChem CID 69274759) has the molecular formula C15H23N3O5Si and a molecular weight of 353.45 g/mol. Its IUPAC name is (3,4,8b-trimethyl-2,3a-dihydro-1H-pyrrolo[2,3-b]indol-7-yl) N-methylcarbamate;dihydroxy(oxo)silane.
| Compound Name | (3,4,8b-trimethyl-2,3a-dihydro-1H-pyrrolo[2,3-b]indol-7-yl) N-methylcarbamate;dihydroxy(oxo)silane |
|---|---|
| PubChem CID | 69274759 |
| Molecular Formula | C15H23N3O5Si |
| Molecular Weight | 353.45 g/mol |
| Exact Mass | 353.14 |
| IUPAC Name | (3,4,8b-trimethyl-2,3a-dihydro-1H-pyrrolo[2,3-b]indol-7-yl) N-methylcarbamate;dihydroxy(oxo)silane |
| SMILES | CNC(=O)Oc1ccc2c(c1)C1(C)CCN(C)C1N2C.O=[Si](O)O |
| InChI | InChI=1S/C15H21N3O2.H2O3Si/c1-15-7-8-17(3)13(15)18(4)12-6-5-10(9-11(12)15)20-14(19)16-2;1-4(2)3/h5-6,9,13H,7-8H2,1-4H3,(H,16,19);1-2H |
| InChIKey | VQAOAOWDAMIWKT-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 102.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.45 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|