About 2-[2-[(2-benzyl-1,3-dioxol-4-yl)oxy]ethylamino]acetamide;dihydrochloride
2-[2-[(2-benzyl-1,3-dioxol-4-yl)oxy]ethylamino]acetamide;dihydrochloride (PubChem CID 69277260) has the molecular formula C14H20Cl2N2O4
and a molecular weight of 351.23 g/mol. Its IUPAC name is 2-[2-[(2-benzyl-1,3-dioxol-4-yl)oxy]ethylamino]acetamide;dihydrochloride.
Molecular Properties
| Compound Name | 2-[2-[(2-benzyl-1,3-dioxol-4-yl)oxy]ethylamino]acetamide;dihydrochloride |
| PubChem CID | 69277260 |
| Molecular Formula | C14H20Cl2N2O4 |
| Molecular Weight | 351.23 g/mol |
| Exact Mass | 350.08 |
| IUPAC Name | 2-[2-[(2-benzyl-1,3-dioxol-4-yl)oxy]ethylamino]acetamide;dihydrochloride |
| SMILES | Cl.Cl.NC(=O)CNCCOC1=COC(Cc2ccccc2)O1 |
| InChI | InChI=1S/C14H18N2O4.2ClH/c15-12(17)9-16-6-7-18-14-10-19-13(20-14)8-11-4-2-1-3-5-11;;/h1-5,10,13,16H,6-9H2,(H2,15,17);2*1H |
| InChIKey | ZCFJMSNSSHMOHW-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 82.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.23 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-[(2-benzyl-1,3-dioxol-4-yl)oxy]ethylamino]acetamide;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-[(2-benzyl-1,3-dioxol-4-yl)oxy]ethylamino]acetamide;dihydrochloride?
The IUPAC name of 2-[2-[(2-benzyl-1,3-dioxol-4-yl)oxy]ethylamino]acetamide;dihydrochloride (CID 69277260) is 2-[2-[(2-benzyl-1,3-dioxol-4-yl)oxy]ethylamino]acetamide;dihydrochloride.
What is the SMILES notation for 2-[2-[(2-benzyl-1,3-dioxol-4-yl)oxy]ethylamino]acetamide;dihydrochloride?
The canonical SMILES for 2-[2-[(2-benzyl-1,3-dioxol-4-yl)oxy]ethylamino]acetamide;dihydrochloride is Cl.Cl.NC(=O)CNCCOC1=COC(Cc2ccccc2)O1.
What is the InChIKey of 2-[2-[(2-benzyl-1,3-dioxol-4-yl)oxy]ethylamino]acetamide;dihydrochloride?
The InChIKey is ZCFJMSNSSHMOHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18N2O4.2ClH/c15-12(17)9-16-6-7-18-14-10-19-13(20-14)8-11-4-2-1-3-5-11;;/h1-5,10,13,16H,6-9H2,(H2,15,17);2*1H.
What are the key properties of 2-[2-[(2-benzyl-1,3-dioxol-4-yl)oxy]ethylamino]acetamide;dihydrochloride?
2-[2-[(2-benzyl-1,3-dioxol-4-yl)oxy]ethylamino]acetamide;dihydrochloride has a molecular weight of 351.23 g/mol, XLogP of 1.34, 8 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-[(2-benzyl-1,3-dioxol-4-yl)oxy]ethylamino]acetamide;dihydrochloride is sourced from PubChem (CID 69277260), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).